CAS 31529-46-1
:1-Amino-2-methylindoline
Description:
1-Amino-2-methylindoline is an organic compound characterized by its indoline structure, which consists of a fused benzene and pyrrole ring. This compound features an amino group (-NH2) and a methyl group (-CH3) attached to the indoline framework, influencing its chemical reactivity and properties. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. The presence of the amino group allows for hydrogen bonding, which can affect its solubility in various solvents, often making it soluble in polar solvents. 1-Amino-2-methylindoline can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in organic synthesis and materials science. Additionally, its derivatives may have applications in pharmaceuticals, dyes, and agrochemicals. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C9H12N2
InChI:InChI=1S/C9H12N2/c1-7-6-8-4-2-3-5-9(8)11(7)10/h2-5,7H,6,10H2,1H3
InChI key:InChIKey=YELHZVMLYJGTFN-UHFFFAOYSA-N
SMILES:NN1C=2C(CC1C)=CC=CC2
Synonyms:- 1-Amino-2,3-dihydro-2-methylindole
- 1H-Indol-1-amine, 2,3-dihydro-2-methyl-
- 2,3-Dihydro-2-methyl-1H-indol-1-amine
- 2-Methyl-2,3-dihydroindol-1-amine
- 2-Methylindolin-1-Amine
- 2-methyl-2,3-dihydro-1H-indol-1-amine
- Indoline, 1-amino-2-methyl-
- N-Amino-2-methylindoline
- 1-Amino-2-methylindoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-Amino-2-methylindoline
CAS:Controlled ProductFormula:C9H12N2Color and Shape:NeatMolecular weight:148.20

