CymitQuimica logo

CAS 3155-43-9

:

octadecane-1,18-diol

Description:
Octadecane-1,18-diol, with the CAS number 3155-43-9, is a long-chain aliphatic diol characterized by its two hydroxyl (-OH) functional groups located at the terminal positions of an 18-carbon straight-chain alkane. This compound is a colorless, waxy solid at room temperature, exhibiting low solubility in water due to its hydrophobic hydrocarbon chain, while being more soluble in organic solvents. Octadecane-1,18-diol has a high melting point, which is typical for long-chain alcohols, and it is known for its lubricating properties and ability to act as a surfactant. It is often used in various applications, including cosmetics, personal care products, and as a plasticizer in polymers. The presence of hydroxyl groups allows for potential hydrogen bonding, which can influence its physical properties and reactivity. Additionally, octadecane-1,18-diol can undergo typical reactions of alcohols, such as oxidation and esterification, making it a versatile compound in organic synthesis and material science.
Formula:C18H38O2
InChI:InChI=1/C18H38O2/c19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20/h19-20H,1-18H2
InChI key:LUUFSCNUZAYHAT-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCO)CCCCCCCCO
Synonyms:
  • 1,18-Octadecanediol
  • Octadecane-1,18-diol
Found 9 products.