CAS 3156-35-2
:1-(3-Chlorophenyl)-2-nitroethene
Description:
1-(3-Chlorophenyl)-2-nitroethene, with the CAS number 3156-35-2, is an organic compound characterized by its nitroalkene structure. It features a nitro group (-NO2) attached to a vinyl group, which is further substituted with a 3-chlorophenyl group. This compound typically exhibits a yellow to orange color and is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of both the nitro and chlorophenyl groups contributes to its reactivity, making it a useful building block in chemical reactions such as nucleophilic additions and cycloadditions. Additionally, the compound's physical properties, such as solubility and melting point, can vary based on the specific conditions and purity. Safety precautions should be taken when handling this substance, as nitro compounds can be hazardous and may pose environmental risks. Overall, 1-(3-Chlorophenyl)-2-nitroethene is a significant compound in the field of synthetic organic chemistry.
Formula:C8H6ClNO2
InChI:InChI=1/C8H6ClNO2/c9-8-3-1-2-7(6-8)4-5-10(11)12/h1-6H/b5-4+
Synonyms:- 1-Chloro-3-(2-nitrovinyl)benzene
- trans-3-Chloro-beta-nitrostyrene
- 1-chloro-3-[(E)-2-nitroethenyl]benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(3-Chlorophenyl)-2-nitroethene
CAS:Formula:C8H6ClNO2Purity:95%Color and Shape:SolidMolecular weight:183.59171-(3-Chlorophenyl)-2-nitroethene
CAS:1-(3-Chlorophenyl)-2-nitroethenePurity:95%Molecular weight:183.59g/mol1-(3-Chlorophenyl)-2-nitroethene
CAS:1-(3-Chlorophenyl)-2-nitroethene is a reagent that is used as an intermediate in the production of fine chemicals, research chemicals, and speciality chemicals. It has been shown to provide a useful scaffold for the synthesis of complex compounds and is also a versatile building block that can be used in a variety of reactions. 1-(3-Chlorophenyl)-2-nitroethene is not intended for use as a drug or food additive.
Formula:C8H6ClNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:183.59 g/mol


