CymitQuimica logo

CAS 315672-60-7

:

2-methylfuran-3-carbohydrazide

Description:
2-Methylfuran-3-carbohydrazide is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a hydrazide functional group, which is indicative of its potential reactivity and applications in various chemical processes. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydrazide moiety. The presence of the methyl group at the second position of the furan ring can influence its chemical reactivity and physical properties, such as boiling and melting points. 2-Methylfuran-3-carbohydrazide may be of interest in medicinal chemistry and materials science, potentially serving as a precursor for the synthesis of more complex molecules or as a building block in the development of pharmaceuticals. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C6H8N2O2
InChI:InChI=1/C6H8N2O2/c1-4-5(2-3-10-4)6(9)8-7/h2-3H,7H2,1H3,(H,8,9)
InChI key:ZFQJEDANHVDMLS-UHFFFAOYSA-N
SMILES:Cc1c(cco1)C(=NN)O
Synonyms:
  • 2-Methyl-3-furohydrazide
  • 2-Methyl-furan-3-carboxylic acid hydrazide
  • 3-Furancarboxylic acid, 2-methyl-, hydrazide
Found 4 products.