CAS 315676-33-6

Ethyl 5′-[(2-chloroacetyl)amino][2,3′-bithiophene]-4′-carboxylate

Description:

Ethyl 5′-[(2-chloroacetyl)amino][2,3′-bithiophene]-4′-carboxylate is a synthetic organic compound characterized by its unique structure, which includes a bithiophene moiety and an ethyl ester functional group. The presence of the 2-chloroacetylamino group introduces both electrophilic and nucleophilic characteristics, making it potentially reactive in various chemical reactions. This compound is likely to exhibit properties typical of bithiophene derivatives, such as enhanced electronic conductivity and potential applications in organic electronics, including organic photovoltaics and field-effect transistors. Additionally, the carboxylate group may contribute to solubility in polar solvents and facilitate interactions with biological systems, suggesting potential applications in medicinal chemistry. The compound's stability, reactivity, and solubility can be influenced by the substituents on the bithiophene backbone, which can affect its overall chemical behavior and potential uses in various fields, including materials science and pharmaceuticals.

Formula: C₁₃H₁₂ClNO₃S₂

InChI: InChI=1/C13H12ClNO3S2/c1-2-18-13(17)11-8(9-4-3-5-19-9)7-20-12(11)15-10(16)6-14/h3-5,7H,2,6H2,1H3,(H,15,16)

InChI key: InChIKey=LOHQWMWMHVSUNS-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(=CSC1NC(CCl)=O)C2=CC=CS2

Synonyms:

• Ethyl 5′-[(2-chloroacetyl)amino][2,3′-bithiophene]-4′-carboxylate
• [2,3'-Bithiophene]-4'-Carboxylic Acid, 5'-[(2-Chloroacetyl)Amino]-, Ethyl Ester
• [2,3′-Bithiophene]-4′-carboxylic acid, 5′-[(chloroacetyl)amino]-, ethyl ester
• Ethyl 5'-[(chloroacetyl)amino]-2,3'-bithiophene-4'-carboxylate

5′-(2-Chloro-acetylamino)-[2,3′]bithiophenyl-4′-carboxylic acid ethyl ester

CAS: 315676-33-6

Formula: C₁₃H₁₂ClNO₃S₂

Purity: 95.0%

Molecular weight: 329.81

Ref: 10-F344967