CAS 31568-91-9
:2-chloroquinolin-8-ol
Description:
2-Chloroquinolin-8-ol is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the second position and a hydroxyl group at the eighth position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly as an antimicrobial and antifungal agent. Its molecular structure allows for interactions with biological targets, making it of interest in drug development. The compound is also notable for its ability to form chelates with metal ions, which can enhance its biological activity. In terms of solubility, 2-chloroquinolin-8-ol is generally soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the quinoline ring. Safety data should be consulted for handling, as with many chemical substances, to ensure proper precautions are taken during use.
Formula:C9H6ClNO
InChI:InChI=1/C9H6ClNO/c10-8-5-4-6-2-1-3-7(12)9(6)11-8/h1-5,12H
SMILES:c1cc2ccc(Cl)nc2c(c1)O
Synonyms:- 8-Quinolinol, 2-Chloro-
- 2-Chloroquinolin-8-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Chloroquinolin-8-ol
CAS:2-Chloroquinolin-8-ol is a chemical compound that binds to the human serum albumin and has cytotoxic effects on cancer cells. It has been shown to be an inhibitor of survivin, a protein that can promote cancer cell survival. 2-Chloroquinolin-8-ol has also been shown to inhibit the proliferation of human epidermoid carcinoma cells in vitro. This agent also inhibits the growth of Trichophyton mentagrophytes, a fungus that causes tinea versicolor, by binding to the ribosomal RNA. The binding constants for 2-chloroquinolin-8-ol were determined using atomic orbital calculations and vibrational spectroscopy. It has also been shown to bind with high affinity to hepg2 cells and cervical cancer cells.Formula:C9H6ClNOPurity:Min. 95%Molecular weight:179.6 g/mol
