CAS 315695-36-4

5,6-dimethyl-2-(prop-2-yn-1-ylsulfanyl)thieno[2,3-d]pyrimidin-4-amine

Description:

5,6-Dimethyl-2-(prop-2-yn-1-ylsulfanyl)thieno[2,3-d]pyrimidin-4-amine is a heterocyclic compound characterized by its complex structure, which includes a thieno[2,3-d]pyrimidine core. This compound features two methyl groups at the 5 and 6 positions, contributing to its hydrophobic character. The presence of a prop-2-yn-1-ylsulfanyl group at the 2 position introduces a sulfur atom, which can enhance the compound's reactivity and potential biological activity. The amine functional group at the 4 position may participate in hydrogen bonding, influencing its solubility and interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the thieno[2,3-d]pyrimidine scaffold can lead to diverse pharmacological properties. Its unique structural features may also affect its stability, solubility, and overall reactivity, making it a subject of study in various chemical and biological contexts.

Formula: C₁₁H₁₁N₃S₂

InChI: InChI=1/C11H11N3S2/c1-4-5-15-11-13-9(12)8-6(2)7(3)16-10(8)14-11/h1H,5H2,2-3H3,(H2,12,13,14)

SMILES: C#CCSc1nc(c2c(C)c(C)sc2n1)N

Synonyms:

• Thieno[2,3-D]Pyrimidin-4-Amine, 5,6-Dimethyl-2-(2-Propyn-1-Ylthio)-
• 5,6-Dimethyl-2-(prop-2-yn-1-ylsulfanyl)thieno[2,3-d]pyrimidin-4-amine

5,6-dimethyl-2-(2-propyn-1-ylthio)thieno[2,3-d]pyrimidin-4-amine

CAS: 315695-36-4

Formula: C₁₁H₁₁N₃S₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 249.35

Ref: 10-F315096