CAS 3157-03-7: 1,3-diphenylimidazolidine-2,4-dione

Description:1,3-Diphenylimidazolidine-2,4-dione, also known as phenylhydantoin, is a chemical compound characterized by its imidazolidine structure featuring two phenyl groups and two carbonyl groups. It is a white to off-white crystalline solid that is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. This compound exhibits a melting point that varies depending on purity and crystalline form. It is known for its applications in medicinal chemistry, particularly as an anticonvulsant agent. The presence of the imidazolidine ring contributes to its biological activity, and the phenyl substituents enhance its lipophilicity, influencing its pharmacokinetics. Additionally, 1,3-diphenylimidazolidine-2,4-dione can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, this compound is significant in both research and therapeutic contexts.

Formula:C₁₅H₁₂N₂O₂

InChI:InChI=1/C15H12N2O2/c18-14-11-16(12-7-3-1-4-8-12)15(19)17(14)13-9-5-2-6-10-13/h1-10H,11H2