CAS 3157-27-5
:1-(1-phenylethyl)-1H-imidazole-5-carboxylic acid
Description:
1-(1-phenylethyl)-1H-imidazole-5-carboxylic acid, with the CAS number 3157-27-5, is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a phenylethyl group, which contributes to its hydrophobic characteristics, and a carboxylic acid functional group that imparts acidic properties. The presence of the carboxylic acid allows for potential interactions such as hydrogen bonding, making it soluble in polar solvents. Its imidazole structure is significant in biological systems, often participating in enzyme catalysis and acting as a building block for various pharmaceuticals. The compound may exhibit biological activity, potentially influencing metabolic pathways or serving as a precursor in the synthesis of more complex molecules. Overall, its unique structure and functional groups make it a compound of interest in medicinal chemistry and organic synthesis.
Formula:C12H12N2O2
InChI:InChI=1/C12H12N2O2/c1-9(10-5-3-2-4-6-10)14-8-13-7-11(14)12(15)16/h2-9H,1H3,(H,15,16)
SMILES:CC(c1ccccc1)n1cncc1C(=O)O
Synonyms:- 1H-Imidazole-5-carboxylic acid, 1-(1-phenylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Etomidate EP Impurity A
CAS:Formula:C12H12N2O2Color and Shape:White To Off-White SolidMolecular weight:216.24
