CAS 31570-97-5

5-hydroxyquinolin-2(1H)-one

Description:

5-Hydroxyquinolin-2(1H)-one, also known as 5-hydroxy-2-quinolinone, is an organic compound characterized by its quinoline structure, which features a hydroxyl group at the 5-position and a carbonyl group at the 2-position. This compound is typically a yellow to orange crystalline solid and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. It exhibits properties that make it of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial and anti-inflammatory effects. The presence of the hydroxyl group contributes to its reactivity and ability to form hydrogen bonds, influencing its interactions with other molecules. Additionally, 5-hydroxyquinolin-2(1H)-one can participate in various chemical reactions, including condensation and oxidation, making it a versatile building block in organic synthesis. Its unique structure and properties make it a subject of research in the development of pharmaceuticals and agrochemicals.

Formula: C₉H₇NO₂

InChI: InChI=1/C9H7NO2/c11-8-3-1-2-7-6(8)4-5-9(12)10-7/h1-5,11H,(H,10,12)

SMILES: c1cc2c(ccc(n2)O)c(c1)O

5-HYDROXYQUINOLIN-2(1H)-ONE

CAS: 31570-97-5

Formula: C₉H₇NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 161.1574

Ref: IN-DA00382Y

Brexpiprazole Impurity 9

CAS: 31570-97-5

Formula: C₉H₇NO₂

Molecular weight: 161.16

Ref: 4Z-B-115011

5-Hydroxyquinolin-2(1H)-one

CAS: 31570-97-5

5-Hydroxyquinolin-2(1H)-one

Formula: C₉H₇NO₂

Purity: 95%

Color and Shape: faint beige/ brown solid

Molecular weight: 161.16g/mol

Ref: 54-OR15208

5-Hydroxyquinolin-2(1H)-one

CAS: 31570-97-5

Formula: C₉H₇NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 161.16

Ref: 10-F218255

5-Hydroxyquinolin-2(1H)-one

Controlled Product

CAS: 31570-97-5

Applications 5-Hydroxyquinolin-2(1H)-one (cas# 31570-97-5) is a compound useful in organic synthesis.

Formula: C₉H₇NO₂

Color and Shape: Neat

Molecular weight: 161.16

Ref: TR-H953325

5-Hydroxyquinolin-2(1H)-one

CAS: 31570-97-5

5-Hydroxyquinolin-2(1H)-one is a chalcone that can be synthesized from 2,5-dihydroxybenzaldehyde and quinoline. It is a bacteriostatic agent that inhibits bacterial growth by binding to the 50S ribosomal subunit, blocking the formation of an antibiotic-substrate complex with the enzyme cell wall synthesis that is required for cell wall biosynthesis, inhibiting protein synthesis and cell division. 5-Hydroxyquinolin-2(1H)-one has shown activity against methicillin resistant Staphylococcus aureus (MRSA) and methicillin resistant Enterococcus faecium. 5-Hydroxyquinolin-2(1H)-one also represses the expression of DNA topoisomerase II genes, which may be associated with its inhibitory effects on bacterial growth.

Formula: C₉H₇NO₂

Purity: Min. 95%

Molecular weight: 161.16 g/mol

Ref: 3D-FH24497