CAS 315702-87-5
:3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]benzoate
Description:
3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]benzoate, with the CAS number 315702-87-5, is a chemical compound characterized by its complex structure, which includes a benzoate moiety linked to a thiazole and pyridine derivative. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the thiazole and pyridine rings suggests that it may engage in various interactions, including hydrogen bonding and π-π stacking, which can influence its biological activity. Additionally, the compound may possess specific functional groups that contribute to its reactivity and stability under different conditions. Its molecular structure allows for potential applications in drug development, particularly in targeting specific biological pathways or receptors. As with many heterocyclic compounds, the synthesis and characterization of this substance are crucial for understanding its properties and potential uses in pharmaceuticals or agrochemicals.
Formula:C15H10N3O2S
InChI:InChI=1/C15H11N3O2S/c19-14(20)10-4-3-5-11(8-10)17-15-18-13(9-21-15)12-6-1-2-7-16-12/h1-9H,(H,17,18)(H,19,20)/p-1
SMILES:c1ccnc(c1)c1csc(=Nc2cccc(c2)C(=O)[O-])[nH]1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-(4-Pyridin-2-yl-thiazol-2-ylamino)benzoic acid
CAS:Color and Shape:SolidMolecular weight:297.3299865722656

