CAS 315702-99-9
:N-(3-methylphenyl)-4-(pyridin-4-yl)-1,3-thiazol-2-amine
Description:
N-(3-methylphenyl)-4-(pyridin-4-yl)-1,3-thiazol-2-amine, with the CAS number 315702-99-9, is a chemical compound characterized by its unique structural features, including a thiazole ring, an amine group, and aromatic substituents. The presence of the 3-methylphenyl group contributes to its hydrophobic characteristics, while the pyridine moiety introduces basicity and potential for hydrogen bonding. This compound is typically studied for its biological activity, particularly in medicinal chemistry, where it may exhibit properties such as antimicrobial or anticancer effects. Its thiazole core is known for its role in various pharmacological applications, making it a subject of interest in drug discovery. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups, influencing its potential applications in pharmaceuticals or agrochemicals. Overall, N-(3-methylphenyl)-4-(pyridin-4-yl)-1,3-thiazol-2-amine represents a versatile scaffold in organic synthesis and medicinal chemistry research.
Formula:C15H13N3S
InChI:InChI=1/C15H13N3S/c1-11-3-2-4-13(9-11)17-15-18-14(10-19-15)12-5-7-16-8-6-12/h2-10H,1H3,(H,17,18)
SMILES:Cc1cccc(c1)N=c1[nH]c(cs1)c1ccncc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Autophagy Inducer, STF-62247
CAS:Formula:C15H13N3SPurity:95%Color and Shape:SolidMolecular weight:267.34884-(Pyridin-4-Yl)-N-(M-Tolyl)Thiazol-2-Amine
CAS:4-(Pyridin-4-Yl)-N-(M-Tolyl)Thiazol-2-AminePurity:95%Molecular weight:267.35g/molSTF-62247
CAS:Formula:C15H13N3SPurity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:267.35STF-62247
CAS:STF-62247 is TGN inhibitor with IC50 of 0.625 μM and 16 μM in RCC4 and RCC4/VHL cells, respectively.
Formula:C15H13N3SPurity:99.6% - 99.67%Color and Shape:SolidMolecular weight:267.35Autophagy Inducer, STF-62247
CAS:Controlled ProductFormula:C15H13N3SColor and Shape:NeatMolecular weight:267.349STF-62247
CAS:STF-62247 is a light-activated drug that has potent antitumor activities in human skin cancer cells. It inhibits protein synthesis by binding to the polysomes and blocking the production of proteins vital for cell division. STF-62247 is used as a chemotherapeutic agent because it induces caspase-independent cell death, which means that the cells die from necrosis rather than apoptosis. The clinical relevance of this compound is currently being explored to evaluate its potential use in treating infectious diseases, such as tuberculosis and leishmaniasis, or radiation injury.Formula:C15H13N3SPurity:Min. 95%Molecular weight:267.35 g/mol







