CAS 315704-66-6

PTC-209

Description:

PTC-209, with the CAS number 315704-66-6, is a small molecule that has garnered attention in the field of medicinal chemistry, particularly for its role as a selective inhibitor of the protein p53. This compound is known for its potential therapeutic applications, particularly in cancer treatment, as it modulates the activity of p53, a crucial tumor suppressor protein involved in regulating the cell cycle and apoptosis. PTC-209 has been studied for its ability to enhance the efficacy of certain chemotherapeutic agents and to induce apoptosis in cancer cells. The compound is characterized by its specific binding affinity to p53, which allows it to exert its effects selectively. Additionally, PTC-209's chemical structure includes various functional groups that contribute to its biological activity and solubility properties. Ongoing research continues to explore its pharmacokinetics, safety profile, and potential applications in combination therapies for various malignancies.

Formula: C17H13Br2N5OS

InChI: InChI=1S/C17H13Br2N5OS/c1-9-15(24-5-3-4-20-16(24)21-9)13-8-26-17(22-13)23-14-11(18)6-10(25-2)7-12(14)19/h3-8H,1-2H3,(H,22,23)

InChI key: XVOOCQSWCCRVDY-UHFFFAOYSA-N

SMILES: CC1=C(N2C=CC=NC2=N1)C3=CSC(=N3)NC4=C(C=C(C=C4Br)OC)Br

N-(2,6-Dibromo-4-Methoxyphenyl)-4-(2-Methylimidazolo[1,2-A]Pyrimidin-3-Yl)-2-Thiazolamide

CAS: 315704-66-6

N-(2,6-Dibromo-4-Methoxyphenyl)-4-(2-Methylimidazolo[1,2-A]Pyrimidin-3-Yl)-2-Thiazolamide

Formula: C₁₇H₁₃Br₂N₅OS

Purity: 98%

Molecular weight: 495.19

Ref: 54-OR1023738

PTC-209 (PTC209

CAS: 315704-66-6

Formula: C₁₇H₁₃Br₂N₅OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 495.1910

Ref: IN-DA00C6HI

PTC-209

CAS: 315704-66-6

PTC-209

Formula: C₁₇H₁₃Br₂N₅OS

Purity: ≥98%

Molecular weight: 495.19

Ref: 54-BUP14394

PTC-209

CAS: 315704-66-6

N-(2,6-Dibromo-4-methoxyphenyl)-4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)thiazol-2-amine

Formula: C₁₇H₁₃Br₂N₅OS

Purity: 98%

Molecular weight: 495.19

Ref: IN-DG559145

PTC-209

CAS: 315704-66-6

PTC-209 is a potent and selective BMI-1 inhibitor.

Formula: C₁₇H₁₃Br₂N₅OS

Purity: 99.43% - 99.88%

Color and Shape: Yellow Solid

Molecular weight: 495.19

Ref: TM-T2345

PTC 209

CAS: 315704-66-6

A small molecule inhibitor of polycomb complex protein BMI-1, a gene often overexpressed in tumors and therefore a popular therapeutic target in cancer. Anti-tumor effects of PTC 209 have been demonstrated in colorectal carcinoma, acute myeloid leukemia, multiple myeloma and head neck squamous cell carcinoma. As a regulator of self-renewal, inhibition of BMI-1 by PTC 209 also reduces growth of colorectal cancer initiating cells.

Formula: C₁₇H₁₃Br₂N₅OS

Purity: Min. 95%

Color and Shape: Solid

Molecular weight: 495.19 g/mol

Ref: 3D-BP165815