CAS 315715-77-6

2-{[2-(4-chlorophenyl)quinazolin-4-yl]amino}ethanol

Description:

2-{[2-(4-chlorophenyl)quinazolin-4-yl]amino}ethanol is a chemical compound characterized by its complex structure, which includes a quinazoline core substituted with a 4-chlorophenyl group and an aminoethanol moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the quinazoline ring, which is known for its role in various pharmacological applications. The amino group in the ethanol side chain can participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the presence of the chlorine atom on the phenyl ring may enhance lipophilicity and affect the compound's interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry for its potential therapeutic applications, particularly in the development of drugs targeting specific diseases. Its unique structural features contribute to its chemical behavior and potential efficacy in biological systems.

Formula: C₁₆H₁₄ClN₃O

InChI: InChI=1/C16H14ClN3O/c17-12-7-5-11(6-8-12)15-19-14-4-2-1-3-13(14)16(20-15)18-9-10-21/h1-8,21H,9-10H2,(H,18,19,20)

SMILES: c1ccc2c(c1)c(=NCCO)nc(c1ccc(cc1)Cl)[nH]2

Synonyms:

• Ethanol, 2-[[2-(4-chlorophenyl)-4-quinazolinyl]amino]-
• 2-{[2-(4-Chlorophenyl)quinazolin-4-yl]amino}ethanol

2-{[2-(4-chlorophenyl)quinazolin-4-yl]amino}ethanol

CAS: 315715-77-6

Purity: 95.0%

Molecular weight: 299.760009765625

Ref: 10-F315194