CAS 31574-87-5: 2,8-Dibromodibenzothiophene

Description:2,8-Dibromodibenzothiophene is an organic compound characterized by its structure, which consists of a dibenzothiophene core with two bromine substituents at the 2 and 8 positions. This compound is part of a class of polycyclic aromatic compounds that contain sulfur, contributing to its unique chemical properties. It typically exhibits a high degree of stability due to the resonance within its aromatic rings. The presence of bromine atoms enhances its reactivity, making it useful in various chemical reactions, including cross-coupling reactions in organic synthesis. Additionally, 2,8-Dibromodibenzothiophene may exhibit interesting electronic properties, which can be exploited in materials science, particularly in the development of organic semiconductors or photovoltaic devices. Its solubility is generally limited in polar solvents, but it may dissolve in non-polar organic solvents. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2,8-Dibromodibenzothiophene is a significant compound in both synthetic organic chemistry and materials research.

Formula:C₁₂H₆Br₂S

InChI:InChI=1/C12H6Br2S/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6H

Synonyms:
2,8-Dibromodibenzo[b,d]thiophene
Dibenzo[B,D]Thiophene, 2,8-Dibromo-
2,8-Dibromo-Dibenzothiophene

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2,8-Dibromodibenzothiophene REF: 3B-D2245CAS: 31574-87-5	>96.0%(GC)	45.00 €~361.00 €	Thu 10 Apr 25
2,8-Dibromodibenzo[b,d]thiophene REF: 10-F216374CAS: 31574-87-5	95.0%	20.00 €~259.00 €	Tue 15 Apr 25
2,8-Dibromodibenzothiophene REF: IN-DA00332CCAS: 31574-87-5	96%	To inquire	Thu 17 Apr 25
2,8-Dibromodibenzo[b,d]thiophene REF: 54-OR96065CAS: 31574-87-5	96+%	32.00 €~1,398.00 €	Mon 21 Apr 25
2,8-Dibromodibenzothiophene REF: 3D-FD62222CAS: 31574-87-5	Min. 95%	To inquire	Thu 29 May 25