CAS 31574-87-5

2,8-Dibromodibenzothiophene

Description:

2,8-Dibromodibenzothiophene is an organic compound characterized by its structure, which consists of a dibenzothiophene core with two bromine substituents at the 2 and 8 positions. This compound is part of a class of polycyclic aromatic compounds that contain sulfur, contributing to its unique chemical properties. It typically exhibits a high degree of stability due to the resonance within its aromatic rings. The presence of bromine atoms enhances its reactivity, making it useful in various chemical reactions, including cross-coupling reactions in organic synthesis. Additionally, 2,8-Dibromodibenzothiophene may exhibit interesting electronic properties, which can be exploited in materials science, particularly in the development of organic semiconductors or photovoltaic devices. Its solubility is generally limited in polar solvents, but it may dissolve in non-polar organic solvents. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2,8-Dibromodibenzothiophene is a significant compound in both synthetic organic chemistry and materials research.

Formula: C₁₂H₆Br₂S

InChI: InChI=1/C12H6Br2S/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6H

SMILES: c1cc2c(cc1Br)c1cc(ccc1s2)Br

Synonyms:

• 2,8-Dibromodibenzo[b,d]thiophene
• Dibenzo[B,D]Thiophene, 2,8-Dibromo-
• 2,8-Dibromo-Dibenzothiophene

2,8-Dibromodibenzothiophene

CAS: 31574-87-5

Formula: C₁₂H₆Br₂S

Purity: >96.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 342.05

Ref: 3B-D2245

2,8-Dibromodibenzo[b,d]thiophene

CAS: 31574-87-5

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 342.04998779296875

Ref: 10-F216374

2,8-Dibromodibenzothiophene

CAS: 31574-87-5

Formula: C₁₂H₆Br₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 342.0490

Ref: IN-DA00332C

2,8-Dibromodibenzo[b,d]thiophene

CAS: 31574-87-5

2,8-Dibromodibenzo[b,d]thiophene

Purity: 96%

Molecular weight: 342.05g/mol

Ref: 54-OR96065

2,8-Dibromodibenzothiophene

CAS: 31574-87-5

2,8-Dibromodibenzothiophene is a chemical compound that has been used in the Suzuki coupling reaction to form heterocycles. The transport properties of 2,8-dibromodibenzothiophene are poor and it is not soluble in water. It has a photophysical property that can be described by the functional theory and molecular modeling. 2,8-Dibromodibenzothiophene has been shown to undergo an irreversible oxidation reaction at high temperatures and under visible light irradiation.

Formula: C₁₂H₆Br₂S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 342.05 g/mol

Ref: 3D-FD62222