CAS 31577-25-0

2-(Bromomethyl)-4-chloro-1-nitrobenzene

Description:

2-(Bromomethyl)-4-chloro-1-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a nitro group, a bromomethyl group, and a chlorine substituent on a benzene ring. This compound typically appears as a solid at room temperature and is known for its reactivity due to the presence of the bromomethyl and nitro groups, which can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The chlorine atom contributes to the compound's overall electron-withdrawing properties, influencing its reactivity and stability. It is often used in organic synthesis as an intermediate for producing other chemical compounds. Safety precautions should be taken when handling this substance, as it may pose health risks, including toxicity and potential environmental hazards. Proper storage and disposal methods are essential to mitigate any risks associated with its use.

Formula: C₇H₅BrClNO₂

InChI: InChI=1/C7H5BrClNO2/c8-4-5-3-6(9)1-2-7(5)10(11)12/h1-3H,4H2

SMILES: c1cc(c(cc1Cl)CBr)N(=O)=O

Synonyms:

• Benzene, 2-(bromomethyl)-4-chloro-1-nitro-

2-(Bromomethyl)-4-chloro-1-nitrobenzene

CAS: 31577-25-0

Formula: C₇H₅BrClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 250.4771

Ref: IN-DA007IV0

2-(Bromomethyl)-4-chloro-1-nitrobenzene

CAS: 31577-25-0

2-(Bromomethyl)-4-chloro-1-nitrobenzene

Purity: 98%

Molecular weight: 250.48g/mol

Ref: 54-OR450030

(2-Bromomethyl)-4-chloro-1-nitrobenzene

CAS: 31577-25-0

Formula: C₇H₅BrClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 250.48

Ref: 10-F092448