CAS 3158-71-2
:4-cyclopropylaniline
Description:
4-Cyclopropylaniline, with the CAS number 3158-71-2, is an organic compound characterized by a cyclopropyl group attached to the para position of an aniline structure. This compound features a benzene ring bonded to an amino group (-NH2) and a cyclopropyl substituent, which introduces unique steric and electronic properties. The presence of the cyclopropyl group can influence the compound's reactivity and stability, often making it more reactive than its non-cyclopropyl counterparts. 4-Cyclopropylaniline is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic cyclopropyl group. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex organic molecules. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C9H11N
InChI:InChI=1/C9H11N/c10-9-5-3-8(4-6-9)7-1-2-7/h3-7H,1-2,10H2
SMILES:C1CC1c1ccc(cc1)N
Synonyms:- 4-Cyclopropylbenzenamine
- Benzenamine, 4-cyclopropyl-
- 4-Cyclopropylaniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Cyclopropylaniline
CAS:<p>4-Cyclopropylaniline</p>Formula:C9H11NPurity:≥95%Color and Shape: clear. darkbrown liquidMolecular weight:133.19g/mol4-Cyclopropylaniline
CAS:<p>4-Cyclopropylaniline is a terminal, mesogenic section with the cycloalkyl group. A liquid crystal is a phase of matter that displays an ordered arrangement of molecules and exhibits properties intermediate between those of liquids and solids. The molecules in a liquid crystal are typically rod- or disc-shaped, but can also be spherical. Liquid crystals have some degree of order at all times, but they may become more or less ordered over time. This can happen because the molecules are able to rotate freely within the liquid crystal's structure. Crystals are solid materials that have an orderly internal atomic structure. Crystals form when atoms or molecules attach to each other in a repeating pattern that extends in all three dimensions. Homologous compounds have similar molecular structures, which means they have similar chemical properties and react similarly with other compounds. The linkage between two adjacent carbon atoms is covalent bonding, while the linkage between two adjacent nitrogen atoms is called a single bond.</p>Formula:C9H11NPurity:Min. 95%Molecular weight:133.19 g/mol



