CAS 31586-77-3
:Bismuth sodium tartrate
Description:
Bismuth sodium tartrate is a chemical compound that serves primarily as a pharmaceutical agent. It is a bismuth salt of tartaric acid, characterized by its complex structure that includes bismuth, sodium, and tartrate ions. This compound is typically encountered as a white to off-white crystalline powder, which is soluble in water, making it suitable for various applications in medicine. Bismuth sodium tartrate is known for its use in treating gastrointestinal disorders, particularly in the management of peptic ulcers and dyspepsia, due to its protective effects on the gastric mucosa. Additionally, it exhibits antimicrobial properties, contributing to its therapeutic efficacy. The compound's stability and solubility are influenced by pH and temperature, which are important considerations in its formulation and storage. Safety data indicates that while it is generally well-tolerated, it may cause side effects in some individuals, necessitating careful monitoring during use. Overall, bismuth sodium tartrate is a valuable compound in the field of medicinal chemistry, with specific characteristics that enhance its utility in clinical applications.
Formula:C4H6O6·xBi·xNa
InChI:InChI=1S/C4H6O6.Bi.Na/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/t1-,2-;;/m1../s1
InChI key:InChIKey=MIFKGXSJXKRFBP-OLXYHTOASA-N
SMILES:[C@@H]([C@H](C(O)=O)O)(C(O)=O)O.[Bi].[Na]
Synonyms:- Bismuth(3+) Sodium 2,3-Dihydroxybutanedioate (1:1:2)
- Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, bismuth sodium salt
- Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, bismuth sodium salt (1:?:?)
- Butanedioic acid, 2,3-dihydroxy-[R-(R*,R*)]-, bismuth sodium salt
- NSC 302012
- Natrol
- Sodium bismuth tartrate
- Sodium bismuthyl tartrate
- Tartaric acid bismuth complex sodium salt
- Tartaric acid, bismuth sodium salt
- Tartrol
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Bismuth Sodium Tartrate
CAS:Formula:C12H12BiO18·3NaColor and Shape:White To Off-White SolidMolecular weight:653.20 3 22.99Bismuth Sodium rac-Tartrate
CAS:Controlled ProductFormula:C4H2O6·Bi·NaColor and Shape:NeatMolecular weight:378.025

