CAS 316-41-6: Berberine, sulfate
Description:Berberine sulfate is a quaternary ammonium salt derived from the isoquinoline alkaloid berberine, which is commonly found in various plants, including goldenseal and barberry. It is characterized by its bright yellow color and is known for its potential pharmacological properties, including antimicrobial, anti-inflammatory, and antidiabetic effects. The sulfate form enhances its solubility in water, making it more bioavailable for various applications, particularly in herbal medicine and dietary supplements. Berberine sulfate exhibits a complex mechanism of action, influencing multiple biochemical pathways, including glucose metabolism and lipid regulation. Additionally, it has been studied for its potential role in modulating gut microbiota and supporting cardiovascular health. While generally considered safe, berberine sulfate can interact with certain medications, and its use should be approached with caution, particularly in individuals with underlying health conditions or those taking other pharmaceuticals. Overall, berberine sulfate is a compound of significant interest in both traditional and modern medicine due to its diverse therapeutic potential.
Formula:C20H18NO4O4S
InChI:InChI=1S/C20H18NO4.H2O4S/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2;1-5(2,3)4/h3-4,7-10H,5-6,11H2,1-2H3;(H2,1,2,3,4)/q+1;/p-2
InChI key:InChIKey=JISRTQBQFQMSLG-UHFFFAOYSA-L
SMILES:O=S(=O)([O-])[O-].O(C=1C=CC2=CC=3C4=CC=5OCOC5C=C4CC[N+]3C=C2C1OC)C
- Synonyms:
- 5,6-Dihydro-9,10-dimethoxybenzo(g)-1,3-benzodioxolo(5,6-a)quinolizinium sulfate
- Benzo[g]-1,3-benzodioxolo[5,6-a]quinolizinium, 5,6-dihydro-9,10-dimethoxy-, sulfate (2:1)
- Berberine sulfate (2:1)
- Berberine, sulfate
- Berbinium, 7,8,13,13a-tetradehydro-9,10-dimethoxy-2,3-(methylenedioxy)-, sulfate (1:1)
- Berbinium, 7,8,13,13a-tetradehydro-9,10-dimethoxy-2,3-(methylenedioxy)-, sulfate (2:1)
- Bis(9,10-dimethoxy-5,6-dihydro[1,3]dioxolo[4,5-g]isoquino[3,2-a]isoquinolin-7-ium) sulfate
- Bis(9,10-dimethoxy-5,6-dihydro[1,3]dioxolo[4,5-g]isoquinolino[3,2-a]isoquinolin-7-ium) sulfate
- Neutral berberine sulfate
![9,10-Dimethoxy-5,6-dihydro-[1,3]dioxolo[4,5-g]isoquinolino[3,2-a]isoquinolin-7-ium sulfate(2:1)](https://static.cymitquimica.com/products/54/thumb/OR1029961.jpg)
