CAS 316-85-8
:10-[3-(dimethylamino)propyl]-10H-phenothiazin-3-ol
Description:
10-[3-(Dimethylamino)propyl]-10H-phenothiazin-3-ol, commonly known as a phenothiazine derivative, is a chemical compound characterized by its complex structure that includes a phenothiazine core, which is a tricyclic compound containing sulfur and nitrogen atoms. This substance typically exhibits properties such as being a solid at room temperature and having moderate solubility in organic solvents. It is known for its pharmacological applications, particularly in the field of psychiatry, where it functions as an antipsychotic agent. The presence of the dimethylamino group enhances its biological activity by influencing its interaction with neurotransmitter receptors. Additionally, the hydroxyl group contributes to its polar characteristics, affecting its solubility and reactivity. Safety data indicates that it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, this compound is significant in medicinal chemistry due to its therapeutic potential and the role it plays in the development of various pharmaceuticals.
Formula:C17H20N2OS
InChI:InChI=1/C17H20N2OS/c1-18(2)10-5-11-19-14-6-3-4-7-16(14)21-17-12-13(20)8-9-15(17)19/h3-4,6-9,12,20H,5,10-11H2,1-2H3
SMILES:CN(C)CCCN1c2ccccc2Sc2cc(ccc12)O
Synonyms:- 10H-Phenothiazin-3-ol, 10-(3-(dimethylamino)propyl)-
- Phenothiazin-3-ol, 10-[3-(dimethylamino)propyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
3-Hydroxypromazine
CAS:Controlled ProductStability Air Sensitive
Applications 3-Hydroxypromazine is a metabolite of Promazine (P756300); an antipsychotic and tranquilizer.
References Banci, L., et al.: Biochemistry, 38, 3205 (1999); Lawal, O., et al.: Food Chemi., 87, 205 (2004); Shleev, S., et al.: Bioorg. Chem., 35, 35 (2007)Formula:C17H20N2OSColor and Shape:NeatMolecular weight:300.423-Hydroxypromazine-d6
CAS:Controlled ProductFormula:C17D6H14N2OSColor and Shape:NeatMolecular weight:306.455


