CAS 3160-35-8
:(4-Hydroxybenzylidene)acetone
Description:
(4-Hydroxybenzylidene)acetone, also known by its CAS number 3160-35-8, is an organic compound characterized by its structure, which features a benzylidene group attached to an acetone moiety. This compound typically appears as a yellow to orange solid and is known for its potential applications in various fields, including organic synthesis and materials science. It exhibits properties such as being a potential ligand in coordination chemistry and may show biological activity, including antioxidant properties. The presence of both hydroxyl and carbonyl functional groups in its structure contributes to its reactivity, allowing it to participate in various chemical reactions, such as condensation and polymerization. Additionally, (4-Hydroxybenzylidene)acetone can undergo tautomerization, leading to different structural forms. Its solubility varies depending on the solvent, and it is generally more soluble in organic solvents than in water. Overall, this compound is of interest for its versatile chemical behavior and potential applications in research and industry.
Formula:C10H10O2
InChI:InChI=1S/C10H10O2/c1-8(11)2-3-9-4-6-10(12)7-5-9/h2-7,12H,1H3
InChI key:InChIKey=OCNIKEFATSKIBE-UHFFFAOYSA-N
SMILES:C(=CC(C)=O)C1=CC=C(O)C=C1
Synonyms:- (3E)-4-(4-hydroxyphenyl)but-3-en-2-one
- (4-Hydroxybenzylidene)acetone
- 3-Buten-2-one, 4-(4-hydroxyphenyl)-
- 3-Buten-2-one, 4-(p-hydroxyphenyl)-
- 4-(4-Hydroxyphenyl)-3-buten-2-one
- 4-(4-Hydroxyphenyl)But-3-En-2-One
- 4-(4-Hydroxyphenyl)but-3-ene-2-one
- 4-(p-Hydroxyphenyl)-3-buten-2-one
- 4-Hydroxybenzalacetone
- 4-Hydroxybenzylidenacetone
- 4-Hydroxybenzylideneacetone
- 4-Hydroxystyryl methyl ketone
- NSC 26516
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(4-Hydroxyphenyl)-3-buten-2-one
CAS:Formula:C10H10O2Purity:>98.0%(GC)Color and Shape:White - Yellow Solid FormMolecular weight:162.194-Hydroxybenzylideneacetone, 97%
CAS:4-Hydroxybenzylideneacetone is used in the synthesis of 4-(4-hydroxy-phenyl)-butan-2-one. This reaction needs the reagents of cyclohexane and AlCl3, and the solvent of CH2Cl2. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation aFormula:C10H10O2Purity:97%Color and Shape:Pale yellow to yellow, Crystals or powder or crystalline powderMolecular weight:162.194-(4-Hydroxyphenyl)but-3-en-2-one
CAS:Formula:C10H10O2Purity:98%Color and Shape:SolidMolecular weight:162.18524-(4-Hydroxyphenyl)But-3-En-2-One
CAS:4-(4-Hydroxyphenyl)But-3-En-2-OnePurity:98%Molecular weight:162.19g/mol4-Hydroxybenzylideneacetone
CAS:Applications 4-Hydroxybenzylideneacetone is a reagent in the synthesis of anti-proliferative agents with 2-nitrophenylacetonitrile moieties.
References Zhang, X. et al.: Org. Biomol. Chem., 12, 355 (2014);Formula:C10H10O2Color and Shape:NeatMolecular weight:162.19





