CAS 316173-57-6: 2-(2-Furanyl)-7-[3-(4-methoxyphenyl)propyl]-7H-pyrazolo[4,3-e][1,2,4]triazolo[1,5-c]pyrimidin-5-amine
Description:The chemical substance known as 2-(2-Furanyl)-7-[3-(4-methoxyphenyl)propyl]-7H-pyrazolo[4,3-e][1,2,4]triazolo[1,5-c]pyrimidin-5-amine, with the CAS number 316173-57-6, is a complex organic compound characterized by its multi-ring structure, which includes a pyrazolo and triazolo moiety fused to a pyrimidine ring. This compound features a furanyl group and a propyl chain substituted with a methoxyphenyl group, contributing to its unique chemical properties. It is likely to exhibit biological activity due to its structural features, which may interact with various biological targets. The presence of nitrogen atoms in its heterocyclic rings suggests potential for hydrogen bonding and interactions with biomolecules. Additionally, the methoxy group can influence its solubility and lipophilicity, affecting its pharmacokinetic properties. Overall, this compound's intricate structure and functional groups may make it of interest in medicinal chemistry and drug development, particularly in the search for novel therapeutic agents.
Formula:C20H19N7O2
InChI:InChI=1S/C20H19N7O2/c1-28-14-8-6-13(7-9-14)4-2-10-26-18-15(12-22-26)19-23-17(16-5-3-11-29-16)25-27(19)20(21)24-18/h3,5-9,11-12H,2,4,10H2,1H3,(H2,21,24)
InChI key:InChIKey=AEULVFLPCJOBCE-UHFFFAOYSA-N
SMILES:N1=CC=2C3=NC(=NN3C(=NC2N1CCCC4=CC=C(OC)C=C4)N)C=5OC=CC5
- Synonyms:
- 2-(2-Furanyl)-7-[3-(4-methoxyphenyl)propyl]-7H-pyrazolo[4,3-e][1,2,4]triazolo[1,5-c]pyrimidin-5-amine
- 2-furan-2-yl-7-[3-(4-methoxyphenyl)propyl]-7H-pyrazolo[4,3-e][1,2,4]triazolo[1,5-c]pyrimidin-5-amine
- 7H-Pyrazolo[4,3-e][1,2,4]triazolo[1,5-c]pyrimidin-5-amine, 2-(2-furanyl)-7-[3-(4-methoxyphenyl)propyl]-
- Sch-442416