CAS 3163-07-3
:4-nitroresorcinol
Description:
4-Nitroresorcinol, with the CAS number 3163-07-3, is an organic compound characterized by its aromatic structure featuring both hydroxyl (-OH) and nitro (-NO2) functional groups. It is a derivative of resorcinol, specifically substituted at the 4-position with a nitro group. This compound typically appears as a yellow to orange crystalline solid and is soluble in water and organic solvents. 4-Nitroresorcinol is known for its applications in various fields, including as a reagent in organic synthesis, in the production of dyes, and as an intermediate in the manufacture of pharmaceuticals. Its chemical properties include the ability to undergo electrophilic substitution reactions due to the presence of the nitro group, which can influence the reactivity of the aromatic ring. Additionally, it exhibits antioxidant properties and has been studied for its potential biological activities. However, safety precautions are necessary when handling this compound, as it may pose health risks, including skin and respiratory irritation.
Formula:C6H5NO4
InChI:InChI=1/C6H5NO4/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,8-9H
InChI key:InChIKey=CYEZXDVLBGFROE-UHFFFAOYSA-N
SMILES:c1cc(c(cc1O)O)N(=O)=O
Synonyms:- 1,3-Benzenediol, 4-nitro-
- 4-Nitro-1,3-benzenediol
- 4-Nitro-3-hydroxyphenol
- 4-Nitrobenzene-1,3-Diol
- 4-Nitroresorcin
- 5-Hydroxy-2-nitrophenol
- Resorcinol, 4-nitro-
- 4-Nitroresorcinol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ref: IN-DA0039ZR
1g29.00€5g52.00€10g63.00€15g91.00€25g121.00€50g184.00€75g196.00€100g227.00€250mg25.00€4-Nitrobenzene-1,3-diol
CAS:4-Nitrobenzene-1,3-diolFormula:C6H5NO4Purity:98%Color and Shape: yellow solidMolecular weight:155.11g/mol4-Nitrobenzene-1,3-diol
CAS:4-Nitrobenzene-1,3-diol is a high purity biochemical reagent that can be used in research related to life sciences.Formula:C6H5NO4Purity:95.92%Color and Shape:SolidMolecular weight:155.114-Nitroresorcinol
CAS:4-Nitroresorcinol is a hydroxamic acid that inhibits bacterial growth by reacting with riboflavin, which is essential for the synthesis of flavoproteins and folate. This compound has been shown to have a specific growth rate on the order of 10^-5 and 10^-6 M. The reaction of 4-Nitroresorcinol with riboflavin leads to the production of nitric oxide and hydrogen peroxide, which can lead to the destruction of cells. 4-Nitroresorcinol has been synthesized in an organic solvent using various techniques such as thermal decomposition, photochemical synthesis, and hydrolysis. 4-Nitroresorcinol can be viewed under a microscope using techniques such as electron microscopy or light microscopy.Formula:C6H5NO4Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:155.11 g/mol




