CAS 31638-96-7
:3,4,5-Trimethoxy-N-3-pyridinylbenzamide
Description:
3,4,5-Trimethoxy-N-3-pyridinylbenzamide is a chemical compound characterized by its complex structure, which includes a benzamide moiety substituted with three methoxy groups at the 3, 4, and 5 positions, along with a pyridine ring at the nitrogen atom. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. The presence of methoxy groups enhances its lipophilicity, potentially influencing its biological activity and interaction with various receptors. The pyridine ring contributes to its aromatic character and may participate in hydrogen bonding or coordination with metal ions. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory or neuroprotective effects, although specific biological activities would require further investigation. Overall, 3,4,5-Trimethoxy-N-3-pyridinylbenzamide represents a structurally intriguing molecule with potential applications in drug development and research.
Formula:C15H16N2O4
InChI:InChI=1/C15H16N2O4/c1-19-12-7-10(8-13(20-2)14(12)21-3)15(18)17-11-5-4-6-16-9-11/h4-9H,1-3H3,(H,17,18)
InChI key:InChIKey=PGTYKYABUDWSST-UHFFFAOYSA-N
SMILES:C(NC=1C=CC=NC1)(=O)C2=CC(OC)=C(OC)C(OC)=C2
Synonyms:- 3,4,5-Trimethoxy-N-3-pyridinylbenzamide
- 3,4,5-trimethoxy-N-(pyridin-3-yl)benzamide
- Benzamide, 3,4,5-trimethoxy-N-3-pyridinyl-
- Benzamide, 3,4,5-trimethoxy-N-3-pyridyl-
- 3,4,5-Trimethoxy-N-3-pyridylbenzamide
- Troxipide Impurity 5
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3,4,5-Trimethoxy-N-3-pyridinylbenzamide
CAS:Controlled Product<p>Applications 3,4,5-Trimethoxy-N-3-pyridinylbenzamide is used in the preparation of iridium benzoylaminopyridinium complex.<br>References Navarro, Miquel et al., Dalton Trans. 47, 659-662(2018);<br></p>Formula:C15H16N2O4Color and Shape:NeatMolecular weight:288.298

