CAS 31644-51-6

Ethanesulfonamide, 2-amino-N-cyclohexyl-, hydrochloride (1:1)

Description:

Ethanesulfonamide, 2-amino-N-cyclohexyl-, hydrochloride (1:1), with the CAS number 31644-51-6, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a cyclohexyl group attached to an amino group, contributing to its unique structural and chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. Ethanesulfonamide derivatives are often studied for their potential therapeutic effects, particularly in the context of anti-inflammatory and analgesic activities. The presence of the amino group allows for hydrogen bonding, which can influence its interaction with biological targets. Additionally, the compound's stability and reactivity can be affected by pH and temperature, making it important to consider these factors in experimental settings. Overall, this compound represents a significant area of interest in medicinal chemistry and pharmacology due to its potential applications in drug development.

Formula: C₈H₁₈N₂O₂S·ClH

InChI: InChI=1S/C8H18N2O2S.ClH/c9-6-7-13(11,12)10-8-4-2-1-3-5-8;/h8,10H,1-7,9H2;1H

InChI key: InChIKey=DPTQVQVBUAXYQS-UHFFFAOYSA-N

SMILES: N(S(CCN)(=O)=O)C1CCCCC1.Cl

Synonyms:

• Ethanesulfonamide, 2-amino-N-cyclohexyl-, monohydrochloride
• 2-Amino-N-cyclohexylethane-1-sulfonamide hydrochloride
• Ethanesulfonamide, 2-amino-N-cyclohexyl-, hydrochloride (1:1)

2-Amino-N-cyclohexylethane-1-sulfonamide hydrochloride

CAS: 31644-51-6

Versatile small molecule scaffold

Formula: C₈H₁₉ClN₂O₂S

Purity: Min. 95%

Molecular weight: 242.77 g/mol

Ref: 3D-GBA64451