
CAS 31654-49-6
:Xanthochymusside
Description:
Xanthochymusside, with the CAS number 31654-49-6, is a chemical compound that belongs to the class of flavonoids, which are known for their diverse biological activities. This compound is typically derived from natural sources, particularly plants, and exhibits various pharmacological properties, including antioxidant, anti-inflammatory, and potential anticancer effects. Xanthochymusside is characterized by its complex structure, which includes multiple hydroxyl groups that contribute to its reactivity and interaction with biological systems. Its solubility can vary depending on the solvent, and it may exhibit different behaviors in aqueous versus organic environments. The compound's stability and reactivity can also be influenced by factors such as pH and temperature. Research into xanthochymusside continues to explore its potential therapeutic applications, particularly in the fields of medicine and nutrition, highlighting its importance in phytochemistry and natural product research.
Formula:C36H32O16
InChI:InChI=1S/C36H32O16/c37-12-25-30(45)32(47)33(48)36(52-25)51-24-11-21(44)26-20(43)10-22(14-3-6-17(40)18(41)7-14)49-35(26)28(24)29-31(46)27-19(42)8-16(39)9-23(27)50-34(29)13-1-4-15(38)5-2-13/h1-9,11,22,25,29-30,32-34,36-42,44-45,47-48H,10,12H2/t22-,25+,29-,30+,32-,33+,34+,36+/m0/s1
InChI key:InChIKey=XGQOXAVFFQEOBL-CALYIKIKSA-N
SMILES:O(C=1C(=C2C(=C(O)C1)C(=O)C[C@H](O2)C3=CC(O)=C(O)C=C3)[C@@H]4[C@H](OC=5C(C4=O)=C(O)C=C(O)C5)C6=CC=C(O)C=C6)[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O
Synonyms:- (2S,2′S,3R)-2′-(3,4-Dihydroxyphenyl)-7′-(β-D-glucopyranosyloxy)-2,2′,3,3′-tetrahydro-5,5′,7-trihydroxy-2-(4-hydroxyphenyl)[3,8′-bi-4H-1-benzopyran]-4,4′-dione
- [3,8′-Bi-4H-1-benzopyran]-4,4′-dione, 2′-(3,4-dihydroxyphenyl)-7′-(β-D-glucopyranosyloxy)-2,2′,3,3′-tetrahydro-5,5′,7-trihydroxy-2-(4-hydroxyphenyl)-, (2S,2′S,3R)-
- [3,8′-Bi-4H-1-benzopyran]-4,4′-dione, 2′-(3,4-dihydroxyphenyl)-7′-(β-D-glucopyranosyloxy)-2,2′,3,3′-tetrahydro-5,5′,7-trihydroxy-2-(4-hydroxyphenyl)-, [2S-[2α,3β(R*)]]-
- Xanthochymusside
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Xanthochymusside
CAS:<p>Xanthochymusside is a natural product that can be used as a reference standard. The CAS number of Xanthochymusside is 31654-49-6.</p>Formula:C36H32O16Color and Shape:SolidMolecular weight:720.636
