CymitQuimica logo

CAS 3167-50-8

:

2-Amino-5-pyrimidinecarboxylic acid

Description:
2-Amino-5-pyrimidinecarboxylic acid, also known as 5-aminouracil, is a heterocyclic organic compound characterized by a pyrimidine ring with an amino group and a carboxylic acid functional group. This compound features a molecular structure that includes a six-membered aromatic ring containing nitrogen atoms, which contributes to its basicity and reactivity. It is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents, making it useful in various chemical applications. The presence of both amino and carboxylic acid groups allows for potential interactions in biological systems, including roles in nucleic acid metabolism and as a building block in the synthesis of other biologically relevant molecules. Additionally, 2-amino-5-pyrimidinecarboxylic acid may exhibit properties such as being a weak acid and a potential ligand in coordination chemistry. Its unique structure and functional groups make it of interest in medicinal chemistry and research related to nucleobase analogs.
Formula:C5H5N3O2
InChI:InChI=1S/C5H5N3O2/c6-5-7-1-3(2-8-5)4(9)10/h1-2H,(H,9,10)(H2,6,7,8)
InChI key:InChIKey=CBRLWSXYXSFYSP-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=NC(N)=NC1
Synonyms:
  • 2-Amino-5-carboxypyrimidine
  • 2-Amino-5-pyrimidinecarboxylic acid
  • 2-Aminopyrimidine-5-Carboxylate
  • 5-Pyrimidinecarboxylic acid, 2-amino-
Found 4 products.