CAS 3167-63-3
:Diethyl P-(chloromethyl)phosphonate
Description:
Diethyl P-(chloromethyl)phosphonate, with the CAS number 3167-63-3, is an organophosphorus compound characterized by its phosphonate structure, which includes a phosphorus atom bonded to an oxygen atom and two ethyl groups, along with a chloromethyl group. This compound is typically a colorless to pale yellow liquid and is known for its reactivity due to the presence of the chloromethyl group, which can participate in nucleophilic substitution reactions. It is often used in organic synthesis and as an intermediate in the production of various chemicals, including agrochemicals and pharmaceuticals. The presence of the phosphonate group imparts certain biological activities, making it of interest in research related to pesticides and herbicides. However, like many organophosphorus compounds, it may pose health and environmental risks, necessitating careful handling and adherence to safety protocols. Its properties, such as solubility and stability, can vary depending on the specific conditions and solvents used.
Formula:C5H12ClO3P
InChI:InChI=1S/C5H12ClO3P/c1-3-8-10(7,5-6)9-4-2/h3-5H2,1-2H3
InChI key:InChIKey=MZBIWKMCTWJLPT-UHFFFAOYSA-N
SMILES:P(OCC)(OCC)(CCl)=O
Synonyms:- 1-[Chloromethyl(ethoxy)phosphoryl]oxyethane
- Ai3-51203
- ChloroMethyl-phosphonic acid diethyl ester
- Chloromethylphosphonic acid diethyl ester
- Diethyl P-(chloromethyl)phosphonate
- Diethyl chloromethanephosphonate
- Nsc 67753
- Phosphonic acid, (chloromethyl)-, diethyl ester
- Phosphonic acid, P-(chloromethyl)-, diethyl ester
- Diethyl (chloromethyl)phosphonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Diethyl (Chloromethyl)phosphonate
CAS:Formula:C5H12ClO3PPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:186.57Diethyl (chloromethyl)phosphonate
CAS:Formula:C5H12ClO3PPurity:97%Color and Shape:LiquidMolecular weight:186.5737Diethyl (chloromethyl)phosphonate
CAS:Diethyl (chloromethyl)phosphonateFormula:C5H12ClO3PPurity:99%Color and Shape: clear. almost colourless liquidMolecular weight:186.57374g/molDiethyl (chloromethyl)phosphonate
CAS:Formula:C5H12ClO3PPurity:95%Color and Shape:LiquidMolecular weight:186.57Diethyl (Chloromethyl)phosphonate
CAS:Diethyl (chloromethyl)phosphonate is a molecule that has been used as a chemical reagent and in the synthesis of other organic compounds. It is an asymmetric synthesis and it has been shown to be effective for the treatment of blood pressure, bowel disease, or infectious diseases. The chemical stability of this compound is due to its resistance to nucleophilic attack by water. Diethyl (chloromethyl)phosphonate also has functional groups that are suitable for detergent compositions. This compound can also be used as a precursor in the synthesis of other substances such as caspases, which are enzymes involved in apoptosis.
Formula:C5H12ClO3PPurity:Min. 95%Molecular weight:186.57 g/mol




