CAS 31677-75-5

7-benzyloxytryptamine

Description:

7-Benzyloxytryptamine, also known as 7-BT, is a chemical compound that belongs to the tryptamine family, characterized by its indole structure. It features a benzyl ether group at the 7-position of the tryptamine backbone, which contributes to its unique properties. This compound is often studied for its potential pharmacological effects, particularly in relation to serotonin receptors, as it can act as a selective agonist or antagonist depending on the specific receptor subtype. 7-Benzyloxytryptamine is typically a white to off-white solid and is soluble in organic solvents, but its solubility in water is limited. Its molecular structure allows for various interactions with biological systems, making it of interest in neuropharmacology and medicinal chemistry. Additionally, due to its structural similarity to serotonin, it may influence mood and behavior, although further research is necessary to fully understand its biological implications. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₇H₁₈N₂O

InChI: InChI=1/C17H18N2O/c18-10-9-14-11-19-17-15(14)7-4-8-16(17)20-12-13-5-2-1-3-6-13/h1-8,11,19H,9-10,12,18H2

SMILES: c1ccc(cc1)COc1cccc2c(CCN)c[nH]c12

Synonyms:

• 2-[7-(benzyloxy)-1H-indol-3-yl]ethanamine

7-Benzyloxytryptamine

Controlled Product

CAS: 31677-75-5

7-Benzyloxytryptamine is a tryptamine derivative that binds to the 5-HT2A serotonin receptor. It has been shown to have antidepressant properties in ovary cells and other assays. 7-Benzyloxytryptamine acts as a psychostimulant and produces an increase in synaptic activity in the brain. This compound also has high affinity for 5-hydroxytryptamine (5-HT) receptors, which may be responsible for its antidepressant effects. The compound has been shown to be selective for 5-HT2A receptors, but not for other serotonin receptors such as 5-HT1A or 5-HT2C.

Formula: C₁₇H₁₈N₂O

Color and Shape: Powder

Molecular weight: 266.34 g/mol

Ref: 3D-FB52354

7-Benzyloxytryptamine

Controlled Product

CAS: 31677-75-5

Formula: C₁₇H₁₈N₂O

Color and Shape: Neat

Molecular weight: 266.338

Ref: TR-B288505