CAS 3168-01-2

(8xi,9xi,14xi)-17-hydroxypregn-4-ene-3,20-dione

Description:

The chemical substance known as (8xi,9xi,14xi)-17-hydroxypregn-4-ene-3,20-dione, with the CAS number 3168-01-2, is a steroid hormone that is primarily recognized as a derivative of progesterone. It is characterized by its steroidal structure, which includes a four-ring core typical of steroid compounds, along with specific hydroxyl and ketone functional groups that contribute to its biological activity. This compound plays a significant role in various physiological processes, particularly in the regulation of reproductive functions and the menstrual cycle. It is often involved in the synthesis of other steroid hormones and can act as a precursor in steroidogenesis. The presence of hydroxyl groups enhances its solubility in biological systems, allowing it to interact with specific receptors and exert its effects. Additionally, its stereochemistry is crucial for its biological activity, influencing how it binds to hormone receptors and its overall efficacy in physiological processes.

Formula: C₂₁H₃₀O₃

InChI: InChI=1/C21H30O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h12,16-18,24H,4-11H2,1-3H3/t16?,17?,18?,19-,20-,21-/m0/s1

SMILES: CC(=O)[C@]1(CCC2C3CCC4=CC(=O)CC[C@]4(C)C3CC[C@]12C)O

Synonyms:

• Pregn-4-Ene-3,20-Dione, 17-Hydroxy-, (8Xi,9Xi,14Xi)-

Hydroxyhexamide

CAS: 3168-01-2

Hydroxyhexamide ((±)-Hydroxyhexamid) is a pharmacologically active metabolite of Acetohexamide, used as a hypoglycemic agent.

Formula: C₁₅H₂₂N₂O₄S

Purity: 98.91%

Color and Shape: Solid

Molecular weight: 326.41

Ref: TM-T0150

Hydroxyhexamide

CAS: 3168-01-2

Formula: C₁₅H₂₂N₂O₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 326.4112

Ref: IN-DA00C6J6

Hydroxyhexamide

CAS: 3168-01-2

Hydroxyhexamide

Purity: ≥98%

Molecular weight: 326.41g/mol

Ref: 54-BUP07845

Hydroxyhexamide

CAS: 3168-01-2

Purity: 98%

Molecular weight: 326.4100037

Ref: 10-F545275