CAS 3168-59-0

5-methoxy-2-methylbenzoic acid

Description:

5-Methoxy-2-methylbenzoic acid, with the CAS number 3168-59-0, is an aromatic carboxylic acid characterized by the presence of a methoxy group (-OCH3) and a methyl group (-CH3) attached to a benzoic acid structure. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, while its solubility in water is limited. The presence of the carboxylic acid functional group contributes to its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The methoxy and methyl substituents influence its reactivity and polarity, affecting its interactions in biological systems and potential applications in pharmaceuticals or organic synthesis. Additionally, this compound may exhibit specific biological activities, making it of interest in medicinal chemistry. As with many organic compounds, safety precautions should be observed when handling it, including the use of appropriate personal protective equipment.

Formula: C₉H₁₀O₃

InChI: InChI=1/C9H10O3/c1-6-3-4-7(12-2)5-8(6)9(10)11/h3-5H,1-2H3,(H,10,11)

SMILES: Cc1ccc(cc1C(=O)O)OC

Synonyms:

• 5-Methoxy-2-Methyl Benzoic Acid
• 2-Methyl-5-Methoxybenzoic acid
• 5-Methoxy-o-toluic acid, 6-Methyl-m-anisic acid
• Benzoic acid, 5-methoxy-2-methyl-

5-Methoxy-2-methylbenzoic acid

CAS: 3168-59-0

Formula: C₉H₁₀O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 166.1739

Ref: IN-DA003MU0

5-Methoxy-2-methylbenzoic acid

CAS: 3168-59-0

5-Methoxy-2-methylbenzoic acid

Formula: C₉H₁₀O₃

Purity: 99%

Color and Shape: white solid

Molecular weight: 166.17g/mol

Ref: 54-OR51853

5-Methoxy-2-methylbenzoic acid

CAS: 3168-59-0

5-Methoxy-2-methylbenzoic acid is an intermediate in the synthesis of vitamin D3. It can also be used to synthesize calciferol, a configurationally stable form of vitamin D3 that has been shown to be optically active. Lactonic forms are composed of a 5-methoxy group and a 2-methylbenzoic acid moiety. Enantiomers are compounds with the same chemical formula but different arrangements of their atoms in space and each enantiomer is capable of rotating plane polarized light in opposite directions.

Formula: C₉H₁₀O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 166.17 g/mol

Ref: 3D-FM139661

5-Methoxy-2-methylbenzoic acid

CAS: 3168-59-0

Formula: C₉H₁₀O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 166.176

Ref: 10-F038681