CAS 3168-59-0
:5-methoxy-2-methylbenzoic acid
Description:
5-Methoxy-2-methylbenzoic acid, with the CAS number 3168-59-0, is an aromatic carboxylic acid characterized by the presence of a methoxy group (-OCH3) and a methyl group (-CH3) attached to a benzoic acid structure. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, while its solubility in water is limited. The presence of the carboxylic acid functional group contributes to its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The methoxy and methyl substituents influence its reactivity and polarity, affecting its interactions in biological systems and potential applications in pharmaceuticals or organic synthesis. Additionally, this compound may exhibit specific biological activities, making it of interest in medicinal chemistry. As with many organic compounds, safety precautions should be observed when handling it, including the use of appropriate personal protective equipment.
Formula:C9H10O3
InChI:InChI=1/C9H10O3/c1-6-3-4-7(12-2)5-8(6)9(10)11/h3-5H,1-2H3,(H,10,11)
SMILES:Cc1ccc(cc1C(=O)O)OC
Synonyms:- 5-Methoxy-2-Methyl Benzoic Acid
- 2-Methyl-5-Methoxybenzoic acid
- 5-Methoxy-o-toluic acid, 6-Methyl-m-anisic acid
- Benzoic acid, 5-methoxy-2-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Methoxy-2-methylbenzoic acid
CAS:Formula:C9H10O3Purity:98%Color and Shape:SolidMolecular weight:166.17395-Methoxy-2-methylbenzoic acid
CAS:5-Methoxy-2-methylbenzoic acidFormula:C9H10O3Purity:99%Color and Shape: white solidMolecular weight:166.17g/mol5-Methoxy-2-methylbenzoic acid
CAS:5-Methoxy-2-methylbenzoic acid is an intermediate in the synthesis of vitamin D3. It can also be used to synthesize calciferol, a configurationally stable form of vitamin D3 that has been shown to be optically active. Lactonic forms are composed of a 5-methoxy group and a 2-methylbenzoic acid moiety. Enantiomers are compounds with the same chemical formula but different arrangements of their atoms in space and each enantiomer is capable of rotating plane polarized light in opposite directions.Formula:C9H10O3Purity:Min. 95%Color and Shape:PowderMolecular weight:166.17 g/mol5-Methoxy-2-methylbenzoic acid
CAS:Formula:C9H10O3Purity:98%Color and Shape:SolidMolecular weight:166.176



