CAS 316810-82-9

5-Bromo-7-nitro-1H-indazole

Description:

5-Bromo-7-nitro-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused five-membered and six-membered ring containing nitrogen atoms. The presence of a bromine atom at the 5-position and a nitro group at the 7-position contributes to its unique chemical properties and reactivity. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The nitro group can serve as a site for further chemical modifications, while the bromine atom can facilitate various coupling reactions. Additionally, 5-Bromo-7-nitro-1H-indazole may exhibit interesting electronic properties due to the electron-withdrawing nature of the nitro group and the halogen substituent, which can influence its interactions with biological targets. As with many indazole derivatives, it may also display fluorescence, making it useful in various analytical applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₇H₄BrN₃O₂

InChI: InChI=1S/C7H4BrN3O2/c8-5-1-4-3-9-10-7(4)6(2-5)11(12)13/h1-3H,(H,9,10)

InChI key: InChIKey=UBGVVAXTJXNHFX-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(=CC(Br)=C1)C=NN2

Synonyms:

• 1H-Indazole, 5-bromo-7-nitro-
• 5-Bromo-7-nitro-1H-indazole

5-bromo-7-nitro-1H-indazole

CAS: 316810-82-9

Formula: C₇H₄BrN₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 242.0296

Ref: IN-DA00CK0K

5-Bromo-7-nitro-1H-indazole

CAS: 316810-82-9

5-Bromo-7-nitro-1H-indazole

Formula: C₇H₄BrN₃O₂

Purity: ≥95%

Color and Shape: Brown Solid

Molecular weight: 242.03g/mol

Ref: 54-OR15069

5-Bromo-7-nitro-1H-indazole

CAS: 316810-82-9

Formula: C₇H₄BrN₃O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 242.032

Ref: 10-F091831

5-BROMO-7-NITRO-1H-INDAZOLE

CAS: 316810-82-9

Purity: 95%

Molecular weight: 242.0319977

Ref: 10-F800226