CAS 31685-80-0
:Methyl (1S,4aR,5S,8aR)-5-[2-(2,5-dihydro-2-oxo-3-furanyl)ethyl]decahydro-1,4a-dimethyl-6-methylene-1-naphthalenecarboxylate
Description:
Methyl (1S,4aR,5S,8aR)-5-[2-(2,5-dihydro-2-oxo-3-furanyl)ethyl]decahydro-1,4a-dimethyl-6-methylene-1-naphthalenecarboxylate is a complex organic compound characterized by its intricate molecular structure, which includes multiple chiral centers and functional groups. This substance features a naphthalene core, which is a polycyclic aromatic hydrocarbon, and is further modified with a carboxylate ester group, contributing to its reactivity and potential applications in organic synthesis. The presence of a furan moiety indicates potential biological activity, as furan derivatives are often found in natural products and pharmaceuticals. The compound's stereochemistry, denoted by its specific configuration at various chiral centers, suggests that it may exhibit unique properties and interactions in biological systems. Its molecular weight, solubility, and stability would depend on the specific conditions under which it is studied, making it a candidate for further research in medicinal chemistry and material science. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.
Formula:C21H30O4
InChI:InChI=1S/C21H30O4/c1-14-6-9-17-20(2,11-5-12-21(17,3)19(23)24-4)16(14)8-7-15-10-13-25-18(15)22/h10,16-17H,1,5-9,11-13H2,2-4H3/t16-,17+,20+,21-/m0/s1
InChI key:InChIKey=WTKBZJAWPZXKJU-NLEAXPPASA-N
SMILES:C[C@@]12[C@]([C@](C(OC)=O)(C)CCC1)(CCC(=C)[C@@H]2CCC=3C(=O)OCC3)[H]
Synonyms:- 1-Naphthalenecarboxylic acid, 5-[2-(2,5-dihydro-2-oxo-3-furanyl)ethyl]decahydro-1,4a-dimethyl-6-methylene-, methyl ester, [1S-(1α,4aα,5α,8aβ)]-
- 1-naphthalenecarboxylic acid, 5-[2-(2,5-dihydro-2-oxo-3-furanyl)ethyl]decahydro-1,4a-dimethyl-6-methylene-, methyl ester, (1S,4aR,5S,8aR)-
- Labda-8(20),13-diene-16,19-dioic acid, 15-hydroxy-, γ-lactone, methyl ester
- Methyl (1S,4aR,5S,8aR)-5-[2-(2,5-dihydro-2-oxo-3-furanyl)ethyl]decahydro-1,4a-dimethyl-6-methylene-1-naphthalenecarboxylate
- Pinusolide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pinusolide
CAS:Pinusolide is a platelet activating factor ( PAF) antagonist, it may prove of therapeutic value in the treatment of hypotension, it has antileukemic potential,Formula:C21H30O4Purity:98%Color and Shape:SolidMolecular weight:346.46Pinusolide
CAS:Pinusolide is a sesquiterpene lactone, which is a biologically active compound sourced from the Korean pine tree, specifically from Pinus koraiensis. This compound primarily exhibits anti-inflammatory and neuroprotective properties through its ability to inhibit the NF-kB signaling pathway, which is crucial in the regulation of immune responses and inflammation. By modulating this pathway, Pinusolide can reduce the production of pro-inflammatory cytokines, thereby alleviating inflammation and potentially offering protection against neurodegenerative conditions.
Formula:C21H30O4Purity:Min. 95%Color and Shape:PowderMolecular weight:346.5 g/mol



