CAS 3169-78-6

2-(2,3-Dimethylphenoxy)benzenamine

Description:

2-(2,3-Dimethylphenoxy)benzenamine, with the CAS number 3169-78-6, is an organic compound characterized by its aromatic structure, which includes a phenyl group substituted with an amino group and a phenoxy group. This compound features a dimethyl substitution on the phenoxy ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the amino group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. This compound may be of interest in various applications, including pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its specific reactivity and stability can be influenced by factors such as pH, temperature, and the presence of other functional groups. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₄H₁₅NO

InChI: InChI=1S/C14H15NO/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15/h3-9H,15H2,1-2H3

InChI key: InChIKey=TWLQYCULKQEAPS-UHFFFAOYSA-N

SMILES: O(C1=C(C)C(C)=CC=C1)C2=C(N)C=CC=C2

Synonyms:

• Aniline, o-(2,3-xylyloxy)-
• Benzenamine, 2-(2,3-dimethylphenoxy)-
• 2-(2,3-Dimethylphenoxy)aniline
• 2-(2,3-Dimethylphenoxy)benzenamine