CAS 31697-35-5
:N-hydroxy-L-serinamide
Description:
N-hydroxy-L-serinamide is a chemical compound characterized by its structural features, which include a hydroxyl group (-OH) attached to the nitrogen of the amide functional group, as well as the presence of the amino acid serine. This compound is typically classified as an amino acid derivative and is known for its potential applications in biochemical research and pharmaceutical development. It exhibits properties such as solubility in polar solvents due to the presence of both hydrophilic hydroxyl and amine groups. The compound may participate in various biochemical reactions, including those involving enzyme inhibition or modulation, making it of interest in studies related to metabolic pathways. Additionally, its unique structure allows it to interact with biological systems, potentially influencing cellular processes. As with many chemical substances, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any risks associated with its use.
Formula:C3H8N2O3
InChI:InChI=1/C3H8N2O3/c4-2(1-6)3(7)5-8/h2,6,8H,1,4H2,(H,5,7)/t2-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
