CymitQuimica logo

CAS 31699-14-6

:

4-(4-Iodophenyl)thiazol-2-ylamine

Description:
4-(4-Iodophenyl)thiazol-2-ylamine is an organic compound characterized by its thiazole and aniline functional groups. The thiazole ring contributes to its heterocyclic nature, while the presence of an iodine atom on the phenyl group enhances its reactivity and potential for biological activity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic characteristics. It is often used in medicinal chemistry and research due to its potential as a pharmacophore in drug development. The iodine substituent can influence the compound's electronic properties, making it a candidate for various applications, including as a ligand in coordination chemistry or as a precursor in organic synthesis. Additionally, the thiazole moiety is known for its role in various biological activities, which may include antimicrobial or anticancer properties. Safety data should be consulted for handling and usage, as compounds containing halogens can pose specific health and environmental risks.
Formula:C9H7IN2S
InChI:InChI=1/C9H7IN2S/c10-7-3-1-6(2-4-7)8-5-13-9(11)12-8/h1-5H,(H2,11,12)
InChI key:CBCNLOOXYGEQQZ-UHFFFAOYSA-N
SMILES:c1cc(ccc1c1csc(=N)[nH]1)I
Synonyms:
  • 4-(4-Iodophenyl)-1,3-thiazol-2-amine
Found 5 products.