CAS 317-20-4
:7-Fluoroisatin
Description:
7-Fluoroisatin is a chemical compound characterized by its unique structure, which includes a fluoro substituent at the 7-position of the isatin framework. Isatin itself is a diketopiperazine derivative, and the introduction of the fluorine atom enhances its chemical reactivity and biological activity. This compound typically appears as a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The presence of the fluorine atom can influence the compound's lipophilicity, stability, and binding affinity, making it a subject of interest in drug design. Additionally, 7-Fluoroisatin may exhibit various functional properties, such as fluorescence, which can be useful in analytical chemistry and biological imaging. As with many fluorinated compounds, it is essential to handle 7-Fluoroisatin with care, considering its potential toxicity and environmental impact.
Formula:C8H4FNO3
InChI:InChI=1/C8H4FNO3/c9-4-2-1-3-5-6(4)7(11)13-8(12)10-5/h1-3H,(H,10,12)
SMILES:c1cc(c2c(c1)nc(O)oc2=O)F
Synonyms:- 7-Fluoroindole-1H-2,3-Dione
- 7-Fluoroindole-2,3-Dione
- 7-fluoro-1H-INDOLE-2,3-dione
- 5-(Trifluoromethyl) Istatin
- 7-Fluoroindoline-2,3-Dione
- 6-fluoro-2H-3,1-benzoxazine-2,4(1H)-dione
- 5-fluoro-2H-3,1-benzoxazine-2,4(1H)-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
7-Fluoroisatin
CAS:Formula:C8H4FNO2Purity:>98.0%(GC)(T)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:165.127-Fluoroisatin, 97%
CAS:7-Fluoroisatin is used as the intermediate of cardiovascular, anti-inflammatory and bactericidal drugs. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Ae
Formula:C8H4FNO2Purity:97%Color and Shape:Red, Crystals or powder or crystalline powderMolecular weight:165.121H-Indole-2,3-dione, 7-fluoro-
CAS:Formula:C8H4FNO2Purity:97%Color and Shape:SolidMolecular weight:165.12137-Fluoroisatin
CAS:7-FluoroisatinFormula:C8H4FNO2Purity:98%Color and Shape: red solidMolecular weight:165.12g/mol7-Fluoroisatin
CAS:7-Fluoroisatin is a crystalline compound that can exist as two different polymorphs. The metastable form of 7-fluoroisatin has been shown to have low energy vibrations and hydrogen bonding interactions, which are responsible for the intermolecular hydrogen bonding. 7-Fluoroisatin also has a tautomeric form that exists as a hydrochloride salt, which is not stable in the solid state. The protonated form of 7-fluoroisatin has been shown to be an excellent hydrogen bond acceptor, with the ability to stabilize long range interactions.Formula:C8H4FNO2Purity:Min. 95%Color and Shape:SolidMolecular weight:165.12 g/mol7-Fluoroisatin
CAS:Formula:C8H4FNO2Purity:97%Color and Shape:Crystalline Powder,PowderMolecular weight:165.123






