CAS 317318-96-0

{4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl}methanol

Description:

The chemical substance known as {4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl}methanol, with the CAS number 317318-96-0, is characterized by its complex molecular structure, which includes a thiazole ring, a trifluoromethyl group, and a hydroxymethyl functional group. This compound typically exhibits properties associated with both thiazole derivatives and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the hydroxymethyl group. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the presence of multiple functional groups suggests potential for hydrogen bonding and interactions with biological targets. Overall, this compound may be explored for applications in pharmaceuticals or agrochemicals, given its unique structural features and potential for diverse chemical reactivity.

Formula: C₁₂H₁₀F₃NOS

InChI: InChI=1/C12H10F3NOS/c1-7-10(6-17)18-11(16-7)8-2-4-9(5-3-8)12(13,14)15/h2-5,17H,6H2,1H3

SMILES: Cc1c(CO)sc(c2ccc(cc2)C(F)(F)F)n1

Synonyms:

• 5-(Hydroxymethyl)-4-methyl-2-(4-trifluoromethylphenyl)thiazole

(4-METHYL-2-[4-(TRIFLUOROMETHYL)PHENYL]-1,3-THIAZOL-5-YL)METHANOL

CAS: 317318-96-0

Formula: C₁₂H₁₀F₃NOS

Purity: 99%

Color and Shape: Solid

Molecular weight: 273.2741

Ref: IN-DA00C095

{4-Methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl}methanol

CAS: 317318-96-0

{4-Methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl}methanol

Purity: 95%

Molecular weight: 273.27g/mol

Ref: 54-PC10199

GW 501516 Impurity 1

CAS: 317318-96-0

Formula: C₁₂H₁₀F₃NOS

Molecular weight: 273.27

Ref: 4Z-G-237003

5-(Hydroxymethyl)-4-methyl-2-(4-trifluoromethylphenyl)thiazole

Controlled Product

CAS: 317318-96-0

Applications Intermediate in the production of GW 501516 and its derivatives
References Sznaidman, M., et al.: Bioorg. Med. Chem. Lett., 13, 1517 (2003), Sierra, M., et al.: J. Med. Chem., 50, 685 (2007),

Formula: C₁₂H₁₀F₃NOS

Color and Shape: Neat

Molecular weight: 273.2741

Ref: TR-H947795

{4-Methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl}methanol

CAS: 317318-96-0

Formula: C₁₂H₁₀F₃NOS

Purity: 95%

Molecular weight: 273.27

Ref: 10-F067723