CAS 317319-10-1

methyl (4-hydroxy-2-methylphenoxy)acetate

Description:

Methyl (4-hydroxy-2-methylphenoxy)acetate, with the CAS number 317319-10-1, is an organic compound characterized by its ester functional group. It features a methyl ester derived from the acetylation of a phenolic compound, specifically 4-hydroxy-2-methylphenol. This compound typically exhibits a moderate polarity due to the presence of both hydrophilic (hydroxyl) and hydrophobic (aromatic) groups, which can influence its solubility in various solvents. The presence of the hydroxyl group contributes to its potential reactivity, allowing for hydrogen bonding interactions. Methyl (4-hydroxy-2-methylphenoxy)acetate may be utilized in various applications, including as an intermediate in organic synthesis or in the formulation of agrochemicals and pharmaceuticals. Its structural characteristics suggest it may possess biological activity, although specific biological properties would require further investigation. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.

Formula: C₁₀H₁₂O₄

InChI: InChI=1/C10H12O4/c1-7-5-8(11)3-4-9(7)14-6-10(12)13-2/h3-5,11H,6H2,1-2H3

SMILES: Cc1cc(ccc1OCC(=O)OC)O

Synonyms:

• Methyl-(4-hydroxy-2-methylphenoxy)acetat

Acetic acid, 2-(4-hydroxy-2-methylphenoxy)-, methyl ester

CAS: 317319-10-1

Formula: C₁₀H₁₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 196.1999

Ref: IN-DA00C6E6

Methyl 2-(4-hydroxy-2-methylphenoxy)acetate

CAS: 317319-10-1

Methyl 2-(4-hydroxy-2-methylphenoxy)acetate

Purity: 95%

Molecular weight: 196.20g/mol

Ref: 54-OR944537

Methyl 2-(4-hydroxy-2-methylphenoxy)acetate

CAS: 317319-10-1

Formula: C₁₀H₁₂O₄

Purity: 99%

Molecular weight: 196.202

Ref: 10-F337603