CAS 317319-22-5

2-(4-Chlorophenyl)-4-methyl-5-thiazolemethanol

Description:

2-(4-Chlorophenyl)-4-methyl-5-thiazolemethanol, identified by its CAS number 317319-22-5, is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity. This compound features a chlorophenyl group, enhancing its lipophilicity and potential interactions with biological targets. The presence of a hydroxymethyl group indicates that it may exhibit properties typical of alcohols, such as solubility in polar solvents. The thiazole moiety is known for its role in various pharmacological activities, including antimicrobial and antifungal properties. Additionally, the methyl group on the thiazole ring can influence the compound's steric and electronic properties, potentially affecting its reactivity and binding affinity to biological molecules. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities and safety profiles would require further investigation through experimental studies.

Formula: C₁₁H₁₀ClNOS

InChI: InChI=1S/C11H10ClNOS/c1-7-10(6-14)15-11(13-7)8-2-4-9(12)5-3-8/h2-5,14H,6H2,1H3

InChI key: InChIKey=QUSDORIJKAETMR-UHFFFAOYSA-N

SMILES: C(O)C=1SC(=NC1C)C2=CC=C(Cl)C=C2

Synonyms:

• 5-Thiazolemethanol, 2-(4-chlorophenyl)-4-methyl-
• 2-(4-Chlorophenyl)-4-methyl-5-thiazolemethanol
• [2-(4-Chlorophenyl)-4-methyl-1,3-thiazol-5-yl]methanol
• [2-(4-Chlorophenyl)-4-methylthiazol-5-yl]methanol

[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]methanol

CAS: 317319-22-5

Formula: C₁₁H₁₀ClNOS

Molecular weight: 239.7212

Ref: IN-DA00D4BX

(2-(4-Chlorophenyl)-4-methylthiazol-5-yl)methanol

CAS: 317319-22-5

Versatile small molecule scaffold

Formula: C₁₁H₁₀ClNOS

Purity: Min. 95%

Molecular weight: 239.72 g/mol

Ref: 3D-SMA31922