CAS 317319-23-6

2-(4-Fluorophenyl)-4-methyl-5-thiazolemethanol

Description:

2-(4-Fluorophenyl)-4-methyl-5-thiazolemethanol is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of a fluorophenyl group indicates that there is a fluorine atom attached to a phenyl ring, contributing to the compound's potential biological activity and lipophilicity. The methyl group at the 4-position of the thiazole enhances its hydrophobic characteristics, which can influence its solubility and interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structure suggests potential applications in drug development, particularly in areas targeting specific receptors or enzymes. The thiazole moiety is often associated with diverse biological activities, including antimicrobial and anticancer properties. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the molecular interactions and the environment in which the compound is studied.

Formula: C₁₁H₁₀FNOS

InChI: InChI=1S/C11H10FNOS/c1-7-10(6-14)15-11(13-7)8-2-4-9(12)5-3-8/h2-5,14H,6H2,1H3

InChI key: InChIKey=JENCFLAMJRGILT-UHFFFAOYSA-N

SMILES: C(O)C=1SC(=NC1C)C2=CC=C(F)C=C2

Synonyms:

• 2-(4-Fluorophenyl)-4-methyl-5-thiazolemethanol
• [2-(4-Fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanol
• 5-Thiazolemethanol, 2-(4-fluorophenyl)-4-methyl-

[2-(4-Fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanol

CAS: 317319-23-6

[2-(4-Fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanol

Purity: ≥95%

Molecular weight: 223.27g/mol

Ref: 54-PC50100

[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]methanol

CAS: 317319-23-6

Formula: C₁₁H₁₀FNOS

Purity: 95.0%

Molecular weight: 223.27

Ref: 10-F521139