CAS 317374-08-6
:4-(2-Methylbenzoylamino)-2-methylbenzoic acid
Description:
4-(2-Methylbenzoylamino)-2-methylbenzoic acid, with the CAS number 317374-08-6, is an organic compound characterized by its complex structure, which includes both amide and carboxylic acid functional groups. This compound features a benzene ring substituted with a methyl group and an amide linkage, indicating potential for hydrogen bonding and interactions with other molecules. It is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic components, while the carboxylic acid group may enhance its solubility in polar solvents. The presence of the methyl groups suggests that it may have a relatively low melting point compared to similar compounds without such substituents. Additionally, this compound may possess biological activity, making it of interest in pharmaceutical research. Its synthesis typically involves the reaction of appropriate benzoyl and amino acid derivatives, and it may be used in various applications, including as a building block in organic synthesis or in the development of new materials. Safety data should be consulted for handling and storage guidelines.
Formula:C16H15NO3
InChI:InChI=1S/C16H15NO3/c1-10-5-3-4-6-13(10)15(18)17-12-7-8-14(16(19)20)11(2)9-12/h3-9H,1-2H3,(H,17,18)(H,19,20)
InChI key:InChIKey=KJGSVQLCVULXJU-UHFFFAOYSA-N
SMILES:C(NC1=CC(C)=C(C(O)=O)C=C1)(=O)C2=C(C)C=CC=C2
Synonyms:- 2-Methyl-4-(2-methylbenzamido)benzoic acid
- 2-Methyl-4-(2-methylbenzamido)benzoicacid
- 2-Methyl-4-(2-methylbenzoylamino)benzoic acid
- 2-Methyl-4-[(2-methylbenzoyl)amino]benzoic acid
- 4-(2-Methylbenzoylamino)-2-methylbenzoic acid
- Benzoic acid, 2-methyl-4-[(2-methylbenzoyl)amino]-
- Tolvaptan side chain
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Methyl-4-(2-methylbenzamido)benzoic acid
CAS:2-Methyl-4-(2-methylbenzamido)benzoic acidFormula:C16H15NO3Purity:97%Molecular weight:269.3Benzoic acid, 2-methyl-4-[(2-methylbenzoyl)amino]-
CAS:Formula:C16H15NO3Purity:97%Color and Shape:SolidMolecular weight:269.29522-Methyl-4-(2-methylbenzamido)benzoic acid
CAS:2-Methyl-4-(2-methylbenzamido)benzoic acid is a synthetic drug that has oxidizing properties. It is used as an intermediate in the synthesis of medicines, and can also be used as an intermediate in the synthesis of dyes and pesticides. The structure of this molecule consists of two methyl groups on a benzene ring with two aminobenzoic acid molecules attached to it. This molecule has hydrogen bonds with both aminobenzoic acid groups, one of which has an alkyl group attached to it. 2-Methyl-4-(2-methylbenzamido)benzoic acid crystallizes in the monoclinic system and its molecular weight is 256.24 g/mol.Formula:C16H15NO3Purity:Min. 95%Molecular weight:269.3 g/mol





