CymitQuimica logo

CAS 317375-82-9

:

4-[[[(4-Chlorophenyl)sulfonyl]amino]methyl]cyclohexanecarboxylic acid

Description:
4-[[[(4-Chlorophenyl)sulfonyl]amino]methyl]cyclohexanecarboxylic acid, with CAS number 317375-82-9, is a chemical compound characterized by its complex structure, which includes a cyclohexane ring, a carboxylic acid functional group, and a sulfonamide moiety. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the sulfonamide group. It is often utilized in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. The presence of the 4-chlorophenyl group may influence its biological activity and solubility, making it a subject of interest in medicinal chemistry. Additionally, the compound's structural features suggest potential interactions with biological targets, which can be explored for therapeutic applications. Its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical entities. Overall, this compound represents a significant interest in the field of drug discovery and development.
Formula:C14H18ClNO4S
InChI:InChI=1S/C14H18ClNO4S/c15-12-5-7-13(8-6-12)21(19,20)16-9-10-1-3-11(4-2-10)14(17)18/h5-8,10-11,16H,1-4,9H2,(H,17,18)
InChI key:InChIKey=QSAMXYYSGGMNTJ-UHFFFAOYSA-N
SMILES:S(NCC1CCC(C(O)=O)CC1)(=O)(=O)C2=CC=C(Cl)C=C2
Synonyms:
  • Cyclohexanecarboxylic acid, 4-[[[(4-chlorophenyl)sulfonyl]amino]methyl]-
  • 4-[[[(4-Chlorophenyl)sulfonyl]amino]methyl]cyclohexanecarboxylic acid
Found 0 products.