CAS 31748-44-4

1-methyl-1H-indazole-3-carbonitrile

Description:

1-Methyl-1H-indazole-3-carbonitrile is an organic compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a methyl group at the 1-position and a cyano group (-C≡N) at the 3-position of the indazole ring. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the cyano group contributes to its potential reactivity, making it a useful intermediate in organic synthesis and medicinal chemistry. The compound may also exhibit biological activity, which can be explored for pharmaceutical applications. Its molecular structure allows for various functionalization possibilities, making it a versatile building block in the development of new chemical entities. As with many nitrogen-containing heterocycles, it may also display interesting electronic properties, influencing its behavior in chemical reactions and interactions with biological targets. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₉H₇N₃

InChI: InChI=1/C9H7N3/c1-12-9-5-3-2-4-7(9)8(6-10)11-12/h2-5H,1H3

SMILES: Cn1c2ccccc2c(C#N)n1

1-Methyl-1H-indazole-3-carbonitrile

CAS: 31748-44-4

Formula: C₉H₇N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 157.1720

Ref: IN-DA007IO8

1-Methyl-1H-indazole-3-carbonitrile

CAS: 31748-44-4

1-Methyl-1H-indazole-3-carbonitrile

Purity: 95%

Molecular weight: 157.17g/mol

Ref: 54-OR948461

1-methyl-1H-indazole-3-carbonitrile

CAS: 31748-44-4

Formula: C₉H₇N₃

Purity: 98%

Molecular weight: 157.176

Ref: 10-F311054