CAS 3175-95-9
:Deoxyaconitine
Description:
Deoxyaconitine is a potent alkaloid derived from the plant Aconitum, commonly known as monkshood or wolfsbane. It is classified as a bicyclic compound and is part of the larger family of aconitine alkaloids, which are known for their neurotoxic properties. Deoxyaconitine exhibits a complex molecular structure characterized by multiple rings and functional groups, contributing to its biological activity. The substance is primarily recognized for its effects on the nervous system, where it can act as a sodium channel blocker, leading to potential applications in pharmacology, albeit with significant toxicity risks. Its use is highly regulated due to its potential for causing severe poisoning and its narrow therapeutic window. In terms of physical properties, deoxyaconitine is typically a crystalline solid, and it is soluble in organic solvents but has limited solubility in water. Safety precautions are essential when handling this compound, as it can pose serious health risks if ingested or improperly managed.
Formula:C34H47NO10
InChI:InChI=1S/C34H47NO10/c1-7-35-16-31(17-40-3)14-13-21(41-4)33-20-15-32(39)28(44-30(38)19-11-9-8-10-12-19)22(20)34(45-18(2)36,27(37)29(32)43-6)23(26(33)35)24(42-5)25(31)33/h8-12,20-29,37,39H,7,13-17H2,1-6H3/t20-,21+,22-,23+,24+,25-,26-,27+,28-,29+,31+,32-,33+,34-/m1/s1
InChI key:InChIKey=PHASMOUKYDUAOZ-YNOWHOKFSA-N
SMILES:O(C)[C@@H]1[C@]23[C@]4([C@]([C@H](OC)[C@@]2([C@](COC)(CN4CC)CC1)[H])([C@]5(OC(C)=O)[C@@]6([C@]3(C[C@@](O)([C@@H]6OC(=O)C7=CC=CC=C7)[C@@H](OC)[C@@H]5O)[H])[H])[H])[H]
Synonyms:- 3-Deoxyaconitine
- Aconitane-8,13,14,15-tetrol, 20-ethyl-1,6,16-trimethoxy-4-(methoxymethyl)-, 8-acetate 14-benzoate, (1α,6α,14α,15α,16β)-
- Deoxyaconitine
- Deoxyaconitine, 3-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Deoxyaconitine
CAS:3- Deoxyaconitine is a derivative of Aconitine (A189875), which activates tetrodotoxin-sensitive Na+ channels, inducing presynaptic depolarization, thusFormula:C34H47NO10Purity:98.31% - 99.94%Color and Shape:SolidMolecular weight:629.743-Deoxyaconitine
CAS:3-Deoxyaconitine is a naturally occurring alkaloid, which is isolated from the Aconitum species, a group of plants commonly found in mountainous regions. This diterpenoid alkaloid is known for its complex chemical structure and biological activity. The primary mode of action of 3-Deoxyaconitine involves the modulation of voltage-gated sodium channels. By altering these channels, it can interfere with nerve signal transmission, which underlies its significant analgesic and anti-inflammatory effects.Formula:C34H47NO10Purity:Min. 98 Area-%Molecular weight:629.74 g/mol3-Deoxyaconitine
CAS:Controlled ProductApplications 3-Deoxyaconitine is a derivative of Aconitine (A189875), which activates tetrodotoxin-sensitive Na+ channels, inducing presynaptic depolarization, thus blocking the nerve action potential which, in turn, blocks the release of neurotransmitters and decreases the end plate potential at the neuromuscular junction.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Derbre, S., et al.: Anal. Bioanal. Chem., 398, 1747 (2010), Li, M., et al.: J. Pharm. Biomed. Anal., 53, 1063 (2010),Formula:C34H47NO10Color and Shape:NeatMolecular weight:276.322






