CymitQuimica logo

CAS 31750-45-5

:

2-{4-[(1E)-1,2-diphenylprop-1-en-1-yl]phenoxy}-N,N-dimethylethanamine

Description:
The chemical substance known as 2-{4-[(1E)-1,2-diphenylprop-1-en-1-yl]phenoxy}-N,N-dimethylethanamine, with the CAS number 31750-45-5, is a complex organic compound characterized by its unique structural features. It contains a phenoxy group, which is linked to a dimethylethanamine moiety, and features a diphenylpropene structure that contributes to its potential biological activity. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of multiple aromatic rings suggests that it may have significant π-π stacking interactions, which can affect its stability and interactions with other molecules. Additionally, the compound may possess pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its behavior in biological systems would require further investigation to elucidate its potential applications.
Formula:C25H27NO
InChI:InChI=1/C25H27NO/c1-20(21-10-6-4-7-11-21)25(22-12-8-5-9-13-22)23-14-16-24(17-15-23)27-19-18-26(2)3/h4-17H,18-19H2,1-3H3/b25-20+
Synonyms:
  • (E)-2-(4-(1,2-Diphenyl-1-propenyl)phenoxy)-N,N-dimethylethanamine
  • Ethanamine, 2-(4-(1,2-diphenyl-1-propenyl)phenoxy)-N,N-dimethyl-, (E)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.