CAS 3177-24-0

2,4-dichloropyrimidine-5-carbonitrile

Description:

2,4-Dichloropyrimidine-5-carbonitrile is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains two chlorine substituents at the 2 and 4 positions and a cyano group at the 5 position. This compound is typically a white to light yellow crystalline solid, exhibiting moderate solubility in polar organic solvents. It is known for its role as an intermediate in the synthesis of various pharmaceuticals and agrochemicals, particularly due to the reactivity of the cyano group, which can participate in nucleophilic addition reactions. The presence of chlorine atoms enhances its biological activity and can influence its chemical stability and reactivity. As with many chlorinated compounds, it may exhibit environmental persistence and potential toxicity, necessitating careful handling and disposal. Overall, 2,4-dichloropyrimidine-5-carbonitrile serves as a valuable building block in organic synthesis, contributing to the development of diverse chemical entities.

Formula: C₅HCl₂N₃

InChI: InChI=1/C5HCl2N3/c6-4-3(1-8)2-9-5(7)10-4/h2H

SMILES: C(#N)c1cnc(Cl)nc1Cl

Synonyms:

• 5-Pyrimidinecarbonitrile, 2,4-dichloro-
• 2,4-Dichloro-5-cyanopyrimidine

2,4-Dichloropyrimidine-5-carbonitrile

CAS: 3177-24-0

Formula: C₅HCl₂N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 173.9875

Ref: IN-DA003FQ7

2,4-Dichloro-5-cyanopyrimidine

CAS: 3177-24-0

2,4-Dichloro-5-cyanopyrimidine

Purity: 99%

Molecular weight: 173.99g/mol

Ref: 54-OR480750

2,4-Dichloro-5-cyanopyrimidine

CAS: 3177-24-0

Formula: C₅HCl₂N₃

Purity: 95%

Color and Shape: Solid, Yellow solid

Molecular weight: 173.98

Ref: 10-F049830