CymitQuimica logo

CAS 31770-76-0

:

BENZYL 3-(4-HYDROXYPHENYL)PROPIONATE

Description:
Benzyl 3-(4-hydroxyphenyl)propionate, with the CAS number 31770-76-0, is an organic compound characterized by its ester functional group. It is derived from the reaction of benzyl alcohol and 3-(4-hydroxyphenyl)propionic acid. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in the fields of pharmaceuticals and cosmetics, often utilized for its antioxidant properties. The presence of the hydroxyl group on the phenyl ring contributes to its reactivity and solubility in various organic solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its stability under standard conditions allows for ease of handling and incorporation into formulations. However, as with many organic compounds, safety precautions should be observed when handling it, as it may pose risks if ingested or if it comes into contact with skin.
Formula:C16H16O3
InChI:InChI=1S/C16H16O3/c17-15-9-6-13(7-10-15)8-11-16(18)19-12-14-4-2-1-3-5-14/h1-7,9-10,17H,8,11-12H2
InChI key:QOXWTUFCSBOGAB-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COC(=O)CCC2=CC=C(C=C2)O
Found 4 products.