CAS 31772-89-1
:3-Methyl-2H-azirine-2-carboxylic acid
Description:
3-Methyl-2H-azirine-2-carboxylic acid is a heterocyclic organic compound characterized by its azirine ring structure, which consists of a three-membered nitrogen-containing ring. This compound features a carboxylic acid functional group, contributing to its acidity and reactivity. The presence of the methyl group at the 3-position of the azirine ring influences its chemical properties, potentially affecting its stability and reactivity in various chemical reactions. 3-Methyl-2H-azirine-2-carboxylic acid may exhibit unique properties such as being a potential building block in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Its reactivity can be attributed to the strained nature of the azirine ring, which can undergo various transformations, including ring-opening reactions. Additionally, the compound's solubility and behavior in different solvents can vary based on the functional groups present. Overall, 3-Methyl-2H-azirine-2-carboxylic acid is of interest in the field of organic chemistry for its potential applications and unique structural features.
Formula:C4H5NO2
InChI:InChI=1/C4H5NO2/c1-2-3(5-2)4(6)7/h3H,1H3,(H,6,7)
Synonyms:- 2H-Azirine-2-carboxylic acid, 3-methyl-
- Azirinomycin
- 3-Methyl-2H-azirine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Azirinomycin
CAS:<p>Azirinomycin exhibits activity against both Gram-positive and Gram-negative bacteria.</p>Formula:C4H5NO2Color and Shape:SolidMolecular weight:99.088
