CAS 317802-08-7
:2-[7-(1,3,2-dioxaborinan-2-yl)-9,9-dioctyl-fluoren-2-yl]-1,3,2-dioxaborinane
Description:
The chemical substance known as 2-[7-(1,3,2-dioxaborinan-2-yl)-9,9-dioctyl-fluoren-2-yl]-1,3,2-dioxaborinane, with the CAS number 317802-08-7, is a complex organic compound featuring a boron-containing dioxaborinane structure. This compound is characterized by its unique molecular architecture, which includes a fluorenyl moiety substituted with long alkyl chains (octyl groups), enhancing its solubility in organic solvents and potentially influencing its electronic properties. The presence of dioxaborinane units suggests that it may exhibit interesting reactivity, particularly in coordination chemistry and organic synthesis, due to the boron atom's ability to form stable complexes. Additionally, the compound's structure may impart specific optical properties, making it a candidate for applications in organic electronics, such as light-emitting diodes (OLEDs) or photovoltaic devices. Its stability, solubility, and electronic characteristics would be critical for its performance in such applications, warranting further investigation into its physical and chemical properties.
Formula:C35H52B2O4
InChI:InChI=1/C35H52B2O4/c1-3-5-7-9-11-13-21-35(22-14-12-10-8-6-4-2)33-27-29(36-38-23-15-24-39-36)17-19-31(33)32-20-18-30(28-34(32)35)37-40-25-16-26-41-37/h17-20,27-28H,3-16,21-26H2,1-2H3
SMILES:CCCCCCCCC1(CCCCCCCC)c2cc(ccc2c2ccc(cc12)B1OCCCO1)B1OCCCO1
Synonyms:- 1,3,2-dioxaborinane, 2,2'-(9,9-dioctyl-9H-fluorene-2,7-diyl)bis-
- 2,2'-(9,9-Dioctyl-9H-fluorene-2,7-diyl)bis(1,3,2-dioxaborinane)
- 9,9-Dioctylfluorene-2,7-diboronic acid bis(1,3-propanediol) ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
9,9-Di-n-octylfluorene-2,7-diboronic acid bis(1,3-propanediol) ester, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C35H52B2O4Purity:97%Color and Shape:White, Powder or crystalline powder or crystals or fused solidMolecular weight:558.429,9-Dioctylfluorene-2,7-diboronic acid bis(1,3-propanediol) ester
CAS:Formula:C35H52B2O4Purity:98%Color and Shape:SolidMolecular weight:558.40709,9-Dioctylfluorene-2,7-Diboronic Acid Bis(1,3-Propanediol) Ester
CAS:<p>9,9-Dioctylfluorene-2,7-Diboronic Acid Bis(1,3-Propanediol) Ester</p>Purity:98%Molecular weight:558.41g/mol2,2′-(9,9-Dioctyl-9h-fluorene-2,7-diyl)bis(1,3,2-dioxaborinane)
CAS:Purity:98%Molecular weight:558.4199829



